| Record Information | 
|---|
| Version | 5.0 | 
|---|
| Status | Expected but not Quantified | 
|---|
| Creation Date | 2021-09-23 04:09:20 UTC | 
|---|
| Update Date | 2021-09-23 04:09:21 UTC | 
|---|
| HMDB ID | HMDB0301980 | 
|---|
| Secondary Accession Numbers | None | 
|---|
| Metabolite Identification | 
|---|
| Common Name | Vitexin 6''-O-malonyl 2''-O-xyloside | 
|---|
| Description | Vitexin, also known as apigenin 8-C-glucoside or 8-glycosylapigenin, belongs to the class of organic compounds known as flavonoid 8-C-glycosides. Flavonoid 8-C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to 8-position of a 2-phenylchromen-4-one flavonoid backbone. Vitexin is also described as an apigenin flavone glucoside. Vitexin has been found in passion flower, chasteberry, bamboo leaves, millet and Hawthorn. Vitexin has shown a wide range of pharmacological effects, such as antioxidant, anti-cancer, anti-inflammatory, anti-hyperalgesic, and neuroprotective effects (PMID: 27693342  ). Vitexin has also been shown to directly inhibit thyroid peroxidase and potentially contributes to goiter (PMID: 1696490  ). It is sometimes called a goitrogen. | 
|---|
| Structure | OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)C1=C2OC(=CC(=O)C2=C(O)C=C1O)C1=CC=C(O)C=C1 InChI=1S/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2/t14-,17-,18+,19-,21+/m1/s1  | 
|---|
| Synonyms | | Value | Source | 
|---|
 | Apigenin 8-C-glucoside | ChEBI |  | 8-Glycosyl-apigenin | MeSH |  | 8-Glycosylapigenin | MeSH |  | 8-beta-D-Glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | PhytoBank |  | 8-β-D-Glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | PhytoBank |  | 5,7,4'-Trihydroxyflavone 8-C-beta-D-glucopyranoside | PhytoBank |  | 5,7,4'-Trihydroxyflavone 8-C-β-D-glucopyranoside | PhytoBank |  | 5,7,4’-Trihydroxyflavone 8-C-β-D-glucopyranoside | PhytoBank |  | 8-C-Glucosylapigenin | PhytoBank |  | 8-C-beta-D-Glucopyranosylapigenin | PhytoBank |  | 8-C-β-D-Glucopyranosylapigenin | PhytoBank |  | Apigenin 8-C-beta-D-glucoside | PhytoBank |  | Apigenin 8-C-β-D-glucoside | PhytoBank |  | Apigenin 8-C-beta-glucopyranoside | PhytoBank |  | Apigenin 8-C-β-glucopyranoside | PhytoBank |  | Apigenin-8-C-beta-D-glucopyranoside | PhytoBank |  | Apigenin-8-C-β-D-glucopyranoside | PhytoBank |  | Orientoside | PhytoBank |  | Vitexina | PhytoBank |  | Vitexine | PhytoBank |  
  | 
|---|
| Chemical Formula | C21H20O10 | 
|---|
| Average Molecular Weight | 432.3775 | 
|---|
| Monoisotopic Molecular Weight | 432.10564686 | 
|---|
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-4-one | 
|---|
| Traditional Name | vitexin | 
|---|
| CAS Registry Number | Not Available | 
|---|
| SMILES | OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)C1=C2OC(=CC(=O)C2=C(O)C=C1O)C1=CC=C(O)C=C1  | 
|---|
| InChI Identifier | InChI=1S/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2/t14-,17-,18+,19-,21+/m1/s1  | 
|---|
| InChI Key | SGEWCQFRYRRZDC-VPRICQMDSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Description |  Belongs to the class of organic compounds known as flavonoid 8-c-glycosides. Flavonoid 8-C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to 8-position of a 2-phenylchromen-4-one flavonoid backbone. | 
|---|
| Kingdom | Organic compounds   | 
|---|
| Super Class | Phenylpropanoids and polyketides   | 
|---|
| Class | Flavonoids   | 
|---|
| Sub Class | Flavonoid glycosides   | 
|---|
| Direct Parent | Flavonoid 8-C-glycosides   | 
|---|
| Alternative Parents |  | 
|---|
| Substituents | - Flavonoid-8-c-glycoside
 
- Hydroxyflavonoid
 
- 4'-hydroxyflavonoid
 
- 5-hydroxyflavonoid
 
- 7-hydroxyflavonoid
 
- Flavone
 
- Phenolic glycoside
 
- Hexose monosaccharide
 
- Glycosyl compound
 
- C-glycosyl compound
 
- Chromone
 
- 1-benzopyran
 
- Benzopyran
 
- Pyranone
 
- Phenol
 
- 1-hydroxy-2-unsubstituted benzenoid
 
- Pyran
 
- Monosaccharide
 
- Monocyclic benzene moiety
 
- Benzenoid
 
- Oxane
 
- Heteroaromatic compound
 
- Vinylogous acid
 
- Secondary alcohol
 
- Ether
 
- Dialkyl ether
 
- Organoheterocyclic compound
 
- Oxacycle
 
- Polyol
 
- Primary alcohol
 
- Organic oxide
 
- Organic oxygen compound
 
- Alcohol
 
- Hydrocarbon derivative
 
- Organooxygen compound
 
- Aromatic heteropolycyclic compound
 
  | 
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds | 
|---|
| External Descriptors |  | 
|---|
| Ontology | 
|---|
| Physiological effect | Not Available | 
|---|
| Disposition |  | 
|---|
| Process | Not Available | 
|---|
| Role | Not Available | 
|---|
| Physical Properties | 
|---|
| State | Not Available | 
|---|
| Experimental Molecular Properties | | Property | Value | Reference | 
|---|
 | Melting Point | Not Available | Not Available |  | Boiling Point | Not Available | Not Available |  | Water Solubility | Not Available | Not Available |  | LogP | Not Available | Not Available |  
  | 
|---|
| Experimental Chromatographic Properties | Not Available | 
|---|
| Predicted Molecular Properties |  | 
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference | 
|---|
 | Predicted by Siyang on May 30, 2022 | 10.7209 minutes | 33406817   |  | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 5.15 minutes | 32390414   |  | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1775.2 seconds | 40023050   |  | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 195.5 seconds | 40023050   |  | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 101.1 seconds | 40023050   |  | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 158.9 seconds | 40023050   |  | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 102.1 seconds | 40023050   |  | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 341.5 seconds | 40023050   |  | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 358.6 seconds | 40023050   |  | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 563.8 seconds | 40023050   |  | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 630.7 seconds | 40023050   |  | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 285.0 seconds | 40023050   |  | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1275.5 seconds | 40023050   |  | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 236.7 seconds | 40023050   |  | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 246.4 seconds | 40023050   |  | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 407.1 seconds | 40023050   |  | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 344.6 seconds | 40023050   |  | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 236.1 seconds | 40023050   |  
 Predicted Kovats Retention IndicesDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference | 
|---|
 | Vitexin 6''-O-malonyl 2''-O-xyloside,3TMS,isomer #19 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3993.3 | Semi standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,3TMS,isomer #19 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3989.0 | Standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,3TMS,isomer #19 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 4924.3 | Standard polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TMS,isomer #23 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3855.7 | Semi standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TMS,isomer #23 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3955.3 | Standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TMS,isomer #23 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 4622.6 | Standard polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TMS,isomer #25 | C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3O2)C=C1 | 3879.9 | Semi standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TMS,isomer #25 | C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3O2)C=C1 | 3953.5 | Standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TMS,isomer #25 | C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3O2)C=C1 | 4647.7 | Standard polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TMS,isomer #26 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3906.9 | Semi standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TMS,isomer #26 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3959.1 | Standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TMS,isomer #26 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 4573.2 | Standard polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,5TMS,isomer #17 | C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3O2)C=C1 | 3888.3 | Semi standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,5TMS,isomer #17 | C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3O2)C=C1 | 3913.4 | Standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,5TMS,isomer #17 | C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3O2)C=C1 | 4413.9 | Standard polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,5TMS,isomer #18 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3830.9 | Semi standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,5TMS,isomer #18 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3924.9 | Standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,5TMS,isomer #18 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 4326.8 | Standard polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,5TMS,isomer #19 | C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C([C@@H]4O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3O2)C=C1 | 3870.3 | Semi standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,5TMS,isomer #19 | C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C([C@@H]4O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3O2)C=C1 | 3912.1 | Standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,5TMS,isomer #19 | C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C([C@@H]4O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3O2)C=C1 | 4359.1 | Standard polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,6TMS,isomer #7 | C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C([C@@H]4O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3O2)C=C1 | 3891.4 | Semi standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,6TMS,isomer #7 | C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C([C@@H]4O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3O2)C=C1 | 3885.7 | Standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,6TMS,isomer #7 | C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C([C@@H]4O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3O2)C=C1 | 4169.5 | Standard polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,3TBDMS,isomer #19 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4655.3 | Semi standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,3TBDMS,isomer #19 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4663.2 | Standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,3TBDMS,isomer #19 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4998.7 | Standard polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TBDMS,isomer #23 | CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4784.8 | Semi standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TBDMS,isomer #23 | CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4779.4 | Standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TBDMS,isomer #23 | CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4814.8 | Standard polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TBDMS,isomer #26 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4722.1 | Semi standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TBDMS,isomer #26 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4803.4 | Standard non polar | 33892256   |  | Vitexin 6''-O-malonyl 2''-O-xyloside,4TBDMS,isomer #26 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4768.7 | Standard polar | 33892256   |  
  | 
|---|