Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (19) Show 19 proteins XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2013-05-17 00:55:10 UTC

Update Date

2022-03-07 03:17:43 UTC

HMDB ID

HMDB0060343

Secondary Accession Numbers

HMDB60343

Metabolite Identification

Common Name

2-(S-Glutathionyl)acetyl glutathione

Description

2-(S-Glutathionyl)acetyl glutathione belongs to the class of organic compounds known as oligopeptides. These are organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds. 2-(S-Glutathionyl)acetyl glutathione is a moderately acidic compound (based on its pKa). 2-(S-Glutathionyl)acetyl glutathione exists in all living organisms, ranging from bacteria to humans. These are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 08131209222D          

 47 46  0  0  0  0            999 V2000
   -1.0974    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6197    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3829    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9052    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0461    3.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4763   -0.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4750    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0474    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9039    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8118    1.4289    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   10.3342    1.8414    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.7605    1.8414    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    6.7618    1.4289    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    0.3316    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1908    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3316    4.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1908   -1.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6184    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7605    2.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7618    0.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5263    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0487    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8118    0.6039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3342    2.6664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0461    3.0789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4763    0.1914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0461    1.4289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4763    1.8414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3316    2.6664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1908    0.6039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3829    3.9039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3316    5.1414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9052   -0.6336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1908   -1.8711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6184    2.6664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4750    3.0789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0474    0.1914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2408    1.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5263    2.6664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7631    1.8414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0487    0.6039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1895    1.8414    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.3329    1.4289    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8118    2.2539    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3342    1.0164    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4750    2.2539    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0474    1.0164    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0  0  0  0
  4  2  1  0  0  0  0
 10  1  1  0  0  0  0
 11  2  1  0  0  0  0
 12  7  1  0  0  0  0
 13  8  1  0  0  0  0
 14  3  1  0  0  0  0
 15  4  1  0  0  0  0
 16  5  1  0  0  0  0
 17  6  1  0  0  0  0
 18  9  1  0  0  0  0
 19 12  1  0  0  0  0
 20 13  1  0  0  0  0
 21 10  1  0  0  0  0
 22 11  1  0  0  0  0
 10 23  1  1  0  0  0
 11 24  1  1  0  0  0
 25  5  1  4  0  0  0
 25 19  2  0  0  0  0
 26  6  1  4  0  0  0
 26 20  2  0  0  0  0
 12 27  1  1  0  0  0
 27 14  2  0  0  0  0
 13 28  1  1  0  0  0
 28 15  2  0  0  0  0
 14 29  1  4  0  0  0
 15 30  1  4  0  0  0
 31 16  2  0  0  0  0
 32 16  1  0  0  0  0
 33 17  2  0  0  0  0
 34 17  1  0  0  0  0
 35 18  2  0  0  0  0
 36 19  1  0  0  0  0
 37 20  1  0  0  0  0
 38 21  2  0  0  0  0
 39 21  1  0  0  0  0
 40 22  2  0  0  0  0
 41 22  1  0  0  0  0
 42  7  1  0  0  0  0
 42  9  1  0  0  0  0
 43  8  1  0  0  0  0
 43 18  1  0  0  0  0
 10 44  1  1  0  0  0
 11 45  1  1  0  0  0
 12 46  1  1  0  0  0
 13 47  1  1  0  0  0
M  END

HMDB0060343
     RDKit          3D
2-(S-Glutathionyl)acetyl glutathione
 77 76  0  0  0  0  0  0  0  0999 V2000
   -8.5130   -0.7040   -0.6577 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1741   -1.1243   -0.2478 C   0  0  1  0  0  0  0  0  0  0  0  0
   -6.2066   -0.5977   -1.2589 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7665   -0.9385   -0.9996 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9477   -0.3696   -2.0970 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2302   -0.7200   -3.3975 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9980    0.4275   -1.8627 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5501    0.9093   -0.5841 C   0  0  1  0  0  0  0  0  0  0  0  0
   -1.0920    1.3575   -0.7812 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4117    1.9920    0.7864 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2886    0.6805    2.0162 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6971   -0.3563    1.6332 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8757   -1.2984    2.3737 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6057   -0.2327    0.1215 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7254   -1.6508   -0.0996 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8203   -1.6856    0.9149 C   0  0  2  0  0  0  0  0  0  0  0  0
    4.6948   -0.5630    0.9339 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8953   -0.5276    0.4514 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3690   -1.6922   -0.1404 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7719    0.6295    0.4938 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2472    1.9620    0.1648 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7879    2.2589   -1.2094 C   0  0  2  0  0  0  0  0  0  0  0  0
    5.2960    3.6637   -1.2794 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6632    1.4315   -1.6410 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8109    0.2278   -1.9837 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3551    1.9337   -1.6977 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4995   -3.0051    0.8474 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5274   -3.3320    1.7174 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1502   -3.8842   -0.0247 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7768   -5.1658   -0.1244 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5278   -6.0282    1.0476 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0246   -7.1744    1.0816 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7590   -5.6062    2.1131 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3479    2.0588   -0.1277 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1036    2.6707    1.0800 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3042    2.5082   -0.8788 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1161    3.6321   -0.4789 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8853    4.8192   -1.3087 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0646    4.8033   -2.2428 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5914    5.9796   -1.0509 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9008   -0.5869    1.0886 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8542   -0.8963    1.6979 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8114    0.2863    1.7084 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8914   -1.4164   -1.3047 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4057    0.2116   -1.1248 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1230   -2.2470   -0.2310 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3502    0.5150   -1.3033 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4961   -0.9626   -2.2845 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4627   -0.4364   -0.0384 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5945   -2.0130   -0.8592 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5376   -1.6434   -3.6870 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5287    0.0719    0.1414 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0972    2.1527   -1.5293 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5390    0.4877   -1.1554 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0759    1.1530    2.9579 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2976    0.2591    2.2033 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0645   -2.5576    0.0453 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0424   -1.6750   -1.1445 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2922   -1.6763    1.9246 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9969   -2.0346   -1.0131 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7070    0.4659   -0.1118 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1450    0.6969    1.5716 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4830    2.3200    0.9347 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1033    2.6937    0.3672 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6213    2.2489   -1.9527 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6780    4.1924   -0.4715 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5674    4.1252   -2.1512 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0639    2.5853   -2.4108 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2547   -3.9587    1.4057 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4050   -5.7314   -1.0129 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8955   -5.0857   -0.2465 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7367   -5.6195    2.0910 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8030    3.6483    1.0552 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1823    3.3464   -0.5750 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9572    3.8556    0.6082 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3549    5.9973   -0.4022 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2342   -0.0615    2.5834 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  3
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  3
 18 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  2  0
 24 26  1  0
 16 27  1  0
 27 28  1  0
 27 29  2  3
 29 30  1  0
 30 31  1  0
 31 32  2  0
 31 33  1  0
  8 34  1  0
 34 35  1  0
 34 36  2  3
 36 37  1  0
 37 38  1  0
 38 39  2  0
 38 40  1  0
  2 41  1  0
 41 42  2  0
 41 43  1  0
  1 44  1  0
  1 45  1  0
  2 46  1  1
  3 47  1  0
  3 48  1  0
  4 49  1  0
  4 50  1  0
  6 51  1  0
  8 52  1  1
  9 53  1  0
  9 54  1  0
 11 55  1  0
 11 56  1  0
 15 57  1  0
 15 58  1  0
 16 59  1  1
 19 60  1  0
 20 61  1  0
 20 62  1  0
 21 63  1  0
 21 64  1  0
 22 65  1  6
 23 66  1  0
 23 67  1  0
 26 68  1  0
 28 69  1  0
 30 70  1  0
 30 71  1  0
 33 72  1  0
 35 73  1  0
 37 74  1  0
 37 75  1  0
 40 76  1  0
 43 77  1  0
M  END


  Mrv0541 08131209222D          

 47 46  0  0  0  0            999 V2000
   -1.0974    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6197    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3829    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9052    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0461    3.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4763   -0.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4750    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0474    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9039    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8118    1.4289    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   10.3342    1.8414    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.7605    1.8414    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    6.7618    1.4289    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    0.3316    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1908    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3316    4.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1908   -1.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6184    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7605    2.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7618    0.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5263    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0487    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8118    0.6039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3342    2.6664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0461    3.0789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4763    0.1914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0461    1.4289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4763    1.8414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3316    2.6664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1908    0.6039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3829    3.9039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3316    5.1414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9052   -0.6336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1908   -1.8711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6184    2.6664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4750    3.0789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0474    0.1914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2408    1.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5263    2.6664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7631    1.8414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0487    0.6039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1895    1.8414    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.3329    1.4289    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8118    2.2539    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3342    1.0164    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4750    2.2539    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0474    1.0164    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0  0  0  0
  4  2  1  0  0  0  0
 10  1  1  0  0  0  0
 11  2  1  0  0  0  0
 12  7  1  0  0  0  0
 13  8  1  0  0  0  0
 14  3  1  0  0  0  0
 15  4  1  0  0  0  0
 16  5  1  0  0  0  0
 17  6  1  0  0  0  0
 18  9  1  0  0  0  0
 19 12  1  0  0  0  0
 20 13  1  0  0  0  0
 21 10  1  0  0  0  0
 22 11  1  0  0  0  0
 10 23  1  1  0  0  0
 11 24  1  1  0  0  0
 25  5  1  4  0  0  0
 25 19  2  0  0  0  0
 26  6  1  4  0  0  0
 26 20  2  0  0  0  0
 12 27  1  1  0  0  0
 27 14  2  0  0  0  0
 13 28  1  1  0  0  0
 28 15  2  0  0  0  0
 14 29  1  4  0  0  0
 15 30  1  4  0  0  0
 31 16  2  0  0  0  0
 32 16  1  0  0  0  0
 33 17  2  0  0  0  0
 34 17  1  0  0  0  0
 35 18  2  0  0  0  0
 36 19  1  0  0  0  0
 37 20  1  0  0  0  0
 38 21  2  0  0  0  0
 39 21  1  0  0  0  0
 40 22  2  0  0  0  0
 41 22  1  0  0  0  0
 42  7  1  0  0  0  0
 42  9  1  0  0  0  0
 43  8  1  0  0  0  0
 43 18  1  0  0  0  0
 10 44  1  1  0  0  0
 11 45  1  1  0  0  0
 12 46  1  1  0  0  0
 13 47  1  1  0  0  0
M  END
> <DATABASE_ID>
HMDB0060343

> <DATABASE_NAME>
hmdb

> <SMILES>
[H][C@](N)(CCC(O)=N[C@@]([H])(CSCC(=O)SC[C@]([H])(N=C(O)CC[C@]([H])(N)C(O)=O)C(O)=NCC(O)=O)C(O)=NCC(O)=O)C(O)=O

> <INCHI_IDENTIFIER>
InChI=1S/C22H34N6O13S2/c23-10(21(38)39)1-3-14(29)27-12(19(36)25-5-16(31)32)7-42-9-18(35)43-8-13(20(37)26-6-17(33)34)28-15(30)4-2-11(24)22(40)41/h10-13H,1-9,23-24H2,(H,25,36)(H,26,37)(H,27,29)(H,28,30)(H,31,32)(H,33,34)(H,38,39)(H,40,41)/t10-,11-,12-,13-/m0/s1

> <INCHI_KEY>
QEJUVDVAWJBQIG-CYDGBPFRSA-N

> <FORMULA>
C22H34N6O13S2

> <MOLECULAR_WEIGHT>
654.668

> <EXACT_MASS>
654.162526584

> <JCHEM_ACCEPTOR_COUNT>
19

> <JCHEM_AVERAGE_POLARIZABILITY>
63.017745369878476

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
10

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
(2S)-2-amino-4-{[(1R)-2-[(2-{[(2R)-2-{[(4S)-4-amino-4-carboxy-1-hydroxybutylidene]amino}-2-[(carboxymethyl)-C-hydroxycarbonimidoyl]ethyl]sulfanyl}acetyl)sulfanyl]-1-[(carboxymethyl)-C-hydroxycarbonimidoyl]ethyl]-C-hydroxycarbonimidoyl}butanoic acid

> <ALOGPS_LOGP>
-3.21

> <JCHEM_LOGP>
-2.1541961699999996

> <ALOGPS_LOGS>
-3.84

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
0

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
3.4221501613892515

> <JCHEM_PKA_STRONGEST_ACIDIC>
2.9942701976087567

> <JCHEM_POLAR_SURFACE_AREA>
348.66999999999996

> <JCHEM_REFRACTIVITY>
148.02389999999997

> <JCHEM_ROTATABLE_BOND_COUNT>
23

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
9.54e-02 g/l

> <JCHEM_TRADITIONAL_IUPAC>
(2S)-2-amino-4-{[(1R)-2-[(2-{[(2R)-2-{[(4S)-4-amino-4-carboxy-1-hydroxybutylidene]amino}-2-(carboxymethyl-C-hydroxycarbonimidoyl)ethyl]sulfanyl}acetyl)sulfanyl]-1-(carboxymethyl-C-hydroxycarbonimidoyl)ethyl]-C-hydroxycarbonimidoyl}butanoic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0060343
     RDKit          3D
2-(S-Glutathionyl)acetyl glutathione
 77 76  0  0  0  0  0  0  0  0999 V2000
   -8.5130   -0.7040   -0.6577 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1741   -1.1243   -0.2478 C   0  0  1  0  0  0  0  0  0  0  0  0
   -6.2066   -0.5977   -1.2589 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7665   -0.9385   -0.9996 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9477   -0.3696   -2.0970 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2302   -0.7200   -3.3975 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9980    0.4275   -1.8627 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5501    0.9093   -0.5841 C   0  0  1  0  0  0  0  0  0  0  0  0
   -1.0920    1.3575   -0.7812 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4117    1.9920    0.7864 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2886    0.6805    2.0162 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6971   -0.3563    1.6332 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8757   -1.2984    2.3737 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6057   -0.2327    0.1215 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7254   -1.6508   -0.0996 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8203   -1.6856    0.9149 C   0  0  2  0  0  0  0  0  0  0  0  0
    4.6948   -0.5630    0.9339 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8953   -0.5276    0.4514 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3690   -1.6922   -0.1404 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7719    0.6295    0.4938 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2472    1.9620    0.1648 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7879    2.2589   -1.2094 C   0  0  2  0  0  0  0  0  0  0  0  0
    5.2960    3.6637   -1.2794 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6632    1.4315   -1.6410 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8109    0.2278   -1.9837 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3551    1.9337   -1.6977 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4995   -3.0051    0.8474 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5274   -3.3320    1.7174 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1502   -3.8842   -0.0247 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7768   -5.1658   -0.1244 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5278   -6.0282    1.0476 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0246   -7.1744    1.0816 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7590   -5.6062    2.1131 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3479    2.0588   -0.1277 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1036    2.6707    1.0800 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3042    2.5082   -0.8788 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1161    3.6321   -0.4789 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8853    4.8192   -1.3087 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0646    4.8033   -2.2428 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5914    5.9796   -1.0509 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9008   -0.5869    1.0886 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8542   -0.8963    1.6979 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8114    0.2863    1.7084 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8914   -1.4164   -1.3047 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4057    0.2116   -1.1248 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1230   -2.2470   -0.2310 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3502    0.5150   -1.3033 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4961   -0.9626   -2.2845 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4627   -0.4364   -0.0384 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5945   -2.0130   -0.8592 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5376   -1.6434   -3.6870 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5287    0.0719    0.1414 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0972    2.1527   -1.5293 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5390    0.4877   -1.1554 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0759    1.1530    2.9579 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2976    0.2591    2.2033 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0645   -2.5576    0.0453 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0424   -1.6750   -1.1445 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2922   -1.6763    1.9246 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9969   -2.0346   -1.0131 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7070    0.4659   -0.1118 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1450    0.6969    1.5716 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4830    2.3200    0.9347 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1033    2.6937    0.3672 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6213    2.2489   -1.9527 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6780    4.1924   -0.4715 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5674    4.1252   -2.1512 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0639    2.5853   -2.4108 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2547   -3.9587    1.4057 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4050   -5.7314   -1.0129 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8955   -5.0857   -0.2465 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7367   -5.6195    2.0910 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8030    3.6483    1.0552 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1823    3.3464   -0.5750 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9572    3.8556    0.6082 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3549    5.9973   -0.4022 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2342   -0.0615    2.5834 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  3
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  3
 18 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  2  0
 24 26  1  0
 16 27  1  0
 27 28  1  0
 27 29  2  3
 29 30  1  0
 30 31  1  0
 31 32  2  0
 31 33  1  0
  8 34  1  0
 34 35  1  0
 34 36  2  3
 36 37  1  0
 37 38  1  0
 38 39  2  0
 38 40  1  0
  2 41  1  0
 41 42  2  0
 41 43  1  0
  1 44  1  0
  1 45  1  0
  2 46  1  1
  3 47  1  0
  3 48  1  0
  4 49  1  0
  4 50  1  0
  6 51  1  0
  8 52  1  1
  9 53  1  0
  9 54  1  0
 11 55  1  0
 11 56  1  0
 15 57  1  0
 15 58  1  0
 16 59  1  1
 19 60  1  0
 20 61  1  0
 20 62  1  0
 21 63  1  0
 21 64  1  0
 22 65  1  6
 23 66  1  0
 23 67  1  0
 26 68  1  0
 28 69  1  0
 30 70  1  0
 30 71  1  0
 33 72  1  0
 35 73  1  0
 37 74  1  0
 37 75  1  0
 40 76  1  0
 43 77  1  0
M  END

HEADER    PROTEIN                                 13-AUG-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   13-AUG-12         0                                  
HETATM    1  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   23  N   UNK     0       0.000   0.000   0.000  0.00  0.00           N+0
HETATM   24  N   UNK     0       0.000   0.000   0.000  0.00  0.00           N+0
HETATM   25  N   UNK     0       0.000   0.000   0.000  0.00  0.00           N+0
HETATM   26  N   UNK     0       0.000   0.000   0.000  0.00  0.00           N+0
HETATM   27  N   UNK     0       0.000   0.000   0.000  0.00  0.00           N+0
HETATM   28  N   UNK     0       0.000   0.000   0.000  0.00  0.00           N+0
HETATM   29  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       0.000   0.000   0.000  0.00  0.00           O+0
HETATM   42  S   UNK     0       0.000   0.000   0.000  0.00  0.00           S+0
HETATM   43  S   UNK     0       0.000   0.000   0.000  0.00  0.00           S+0
HETATM   44  H   UNK     0       0.000   0.000   0.000  0.00  0.00           H+0
HETATM   45  H   UNK     0       0.000   0.000   0.000  0.00  0.00           H+0
HETATM   46  H   UNK     0       0.000   0.000   0.000  0.00  0.00           H+0
HETATM   47  H   UNK     0       0.000   0.000   0.000  0.00  0.00           H+0
CONECT    1    3   10                                                       
CONECT    2    4   11                                                       
CONECT    3    1   14                                                       
CONECT    4    2   15                                                       
CONECT    5   16   25                                                       
CONECT    6   17   26                                                       
CONECT    7   12   42                                                       
CONECT    8   13   43                                                       
CONECT    9   18   42                                                       
CONECT   10    1   21   23   44                                             
CONECT   11    2   22   24   45                                             
CONECT   12    7   19   27   46                                             
CONECT   13    8   20   28   47                                             
CONECT   14    3   27   29                                                  
CONECT   15    4   28   30                                                  
CONECT   16    5   31   32                                                  
CONECT   17    6   33   34                                                  
CONECT   18    9   35   43                                                  
CONECT   19   12   25   36                                                  
CONECT   20   13   26   37                                                  
CONECT   21   10   38   39                                                  
CONECT   22   11   40   41                                                  
CONECT   23   10                                                            
CONECT   24   11                                                            
CONECT   25    5   19                                                       
CONECT   26    6   20                                                       
CONECT   27   12   14                                                       
CONECT   28   13   15                                                       
CONECT   29   14                                                            
CONECT   30   15                                                            
CONECT   31   16                                                            
CONECT   32   16                                                            
CONECT   33   17                                                            
CONECT   34   17                                                            
CONECT   35   18                                                            
CONECT   36   19                                                            
CONECT   37   20                                                            
CONECT   38   21                                                            
CONECT   39   21                                                            
CONECT   40   22                                                            
CONECT   41   22                                                            
CONECT   42    7    9                                                       
CONECT   43    8   18                                                       
CONECT   44   10                                                            
CONECT   45   11                                                            
CONECT   46   12                                                            
CONECT   47   13                                                            
MASTER        0    0    0    0    0    0    0    0   47    0   92    0
END

COMPND    HMDB0060343
HETATM    1  N1  UNL     1      -8.513  -0.704  -0.658  1.00  0.00           N  
HETATM    2  C1  UNL     1      -7.174  -1.124  -0.248  1.00  0.00           C  
HETATM    3  C2  UNL     1      -6.207  -0.598  -1.259  1.00  0.00           C  
HETATM    4  C3  UNL     1      -4.767  -0.938  -1.000  1.00  0.00           C  
HETATM    5  C4  UNL     1      -3.948  -0.370  -2.097  1.00  0.00           C  
HETATM    6  O1  UNL     1      -4.230  -0.720  -3.397  1.00  0.00           O  
HETATM    7  N2  UNL     1      -2.998   0.428  -1.863  1.00  0.00           N  
HETATM    8  C5  UNL     1      -2.550   0.909  -0.584  1.00  0.00           C  
HETATM    9  C6  UNL     1      -1.092   1.357  -0.781  1.00  0.00           C  
HETATM   10  S1  UNL     1      -0.412   1.992   0.786  1.00  0.00           S  
HETATM   11  C7  UNL     1      -0.289   0.681   2.016  1.00  0.00           C  
HETATM   12  C8  UNL     1       0.697  -0.356   1.633  1.00  0.00           C  
HETATM   13  O2  UNL     1       0.876  -1.298   2.374  1.00  0.00           O  
HETATM   14  S2  UNL     1       1.606  -0.233   0.121  1.00  0.00           S  
HETATM   15  C9  UNL     1       2.725  -1.651  -0.100  1.00  0.00           C  
HETATM   16  C10 UNL     1       3.820  -1.686   0.915  1.00  0.00           C  
HETATM   17  N3  UNL     1       4.695  -0.563   0.934  1.00  0.00           N  
HETATM   18  C11 UNL     1       5.895  -0.528   0.451  1.00  0.00           C  
HETATM   19  O3  UNL     1       6.369  -1.692  -0.140  1.00  0.00           O  
HETATM   20  C12 UNL     1       6.772   0.630   0.494  1.00  0.00           C  
HETATM   21  C13 UNL     1       6.247   1.962   0.165  1.00  0.00           C  
HETATM   22  C14 UNL     1       5.788   2.259  -1.209  1.00  0.00           C  
HETATM   23  N4  UNL     1       5.296   3.664  -1.279  1.00  0.00           N  
HETATM   24  C15 UNL     1       4.663   1.432  -1.641  1.00  0.00           C  
HETATM   25  O4  UNL     1       4.811   0.228  -1.984  1.00  0.00           O  
HETATM   26  O5  UNL     1       3.355   1.934  -1.698  1.00  0.00           O  
HETATM   27  C16 UNL     1       4.500  -3.005   0.847  1.00  0.00           C  
HETATM   28  O6  UNL     1       5.527  -3.332   1.717  1.00  0.00           O  
HETATM   29  N5  UNL     1       4.150  -3.884  -0.025  1.00  0.00           N  
HETATM   30  C17 UNL     1       4.777  -5.166  -0.124  1.00  0.00           C  
HETATM   31  C18 UNL     1       4.528  -6.028   1.048  1.00  0.00           C  
HETATM   32  O7  UNL     1       5.025  -7.174   1.082  1.00  0.00           O  
HETATM   33  O8  UNL     1       3.759  -5.606   2.113  1.00  0.00           O  
HETATM   34  C19 UNL     1      -3.348   2.059  -0.128  1.00  0.00           C  
HETATM   35  O9  UNL     1      -3.104   2.671   1.080  1.00  0.00           O  
HETATM   36  N6  UNL     1      -4.304   2.508  -0.879  1.00  0.00           N  
HETATM   37  C20 UNL     1      -5.116   3.632  -0.479  1.00  0.00           C  
HETATM   38  C21 UNL     1      -4.885   4.819  -1.309  1.00  0.00           C  
HETATM   39  O10 UNL     1      -4.065   4.803  -2.243  1.00  0.00           O  
HETATM   40  O11 UNL     1      -5.591   5.980  -1.051  1.00  0.00           O  
HETATM   41  C22 UNL     1      -6.901  -0.587   1.089  1.00  0.00           C  
HETATM   42  O12 UNL     1      -5.854  -0.896   1.698  1.00  0.00           O  
HETATM   43  O13 UNL     1      -7.811   0.286   1.708  1.00  0.00           O  
HETATM   44  H1  UNL     1      -8.891  -1.416  -1.305  1.00  0.00           H  
HETATM   45  H2  UNL     1      -8.406   0.212  -1.125  1.00  0.00           H  
HETATM   46  H3  UNL     1      -7.123  -2.247  -0.231  1.00  0.00           H  
HETATM   47  H4  UNL     1      -6.350   0.515  -1.303  1.00  0.00           H  
HETATM   48  H5  UNL     1      -6.496  -0.963  -2.284  1.00  0.00           H  
HETATM   49  H6  UNL     1      -4.463  -0.436  -0.038  1.00  0.00           H  
HETATM   50  H7  UNL     1      -4.594  -2.013  -0.859  1.00  0.00           H  
HETATM   51  H8  UNL     1      -4.538  -1.643  -3.687  1.00  0.00           H  
HETATM   52  H9  UNL     1      -2.529   0.072   0.141  1.00  0.00           H  
HETATM   53  H10 UNL     1      -1.097   2.153  -1.529  1.00  0.00           H  
HETATM   54  H11 UNL     1      -0.539   0.488  -1.155  1.00  0.00           H  
HETATM   55  H12 UNL     1       0.076   1.153   2.958  1.00  0.00           H  
HETATM   56  H13 UNL     1      -1.298   0.259   2.203  1.00  0.00           H  
HETATM   57  H14 UNL     1       2.065  -2.558   0.045  1.00  0.00           H  
HETATM   58  H15 UNL     1       3.042  -1.675  -1.144  1.00  0.00           H  
HETATM   59  H16 UNL     1       3.292  -1.676   1.925  1.00  0.00           H  
HETATM   60  H17 UNL     1       5.997  -2.035  -1.013  1.00  0.00           H  
HETATM   61  H18 UNL     1       7.707   0.466  -0.112  1.00  0.00           H  
HETATM   62  H19 UNL     1       7.145   0.697   1.572  1.00  0.00           H  
HETATM   63  H20 UNL     1       5.483   2.320   0.935  1.00  0.00           H  
HETATM   64  H21 UNL     1       7.103   2.694   0.367  1.00  0.00           H  
HETATM   65  H22 UNL     1       6.621   2.249  -1.953  1.00  0.00           H  
HETATM   66  H23 UNL     1       5.678   4.192  -0.471  1.00  0.00           H  
HETATM   67  H24 UNL     1       5.567   4.125  -2.151  1.00  0.00           H  
HETATM   68  H25 UNL     1       3.064   2.585  -2.411  1.00  0.00           H  
HETATM   69  H26 UNL     1       6.255  -3.959   1.406  1.00  0.00           H  
HETATM   70  H27 UNL     1       4.405  -5.731  -1.013  1.00  0.00           H  
HETATM   71  H28 UNL     1       5.896  -5.086  -0.246  1.00  0.00           H  
HETATM   72  H29 UNL     1       2.737  -5.619   2.091  1.00  0.00           H  
HETATM   73  H30 UNL     1      -2.803   3.648   1.055  1.00  0.00           H  
HETATM   74  H31 UNL     1      -6.182   3.346  -0.575  1.00  0.00           H  
HETATM   75  H32 UNL     1      -4.957   3.856   0.608  1.00  0.00           H  
HETATM   76  H33 UNL     1      -6.355   5.997  -0.402  1.00  0.00           H  
HETATM   77  H34 UNL     1      -8.234  -0.062   2.583  1.00  0.00           H  
CONECT    1    2   44   45
CONECT    2    3   41   46
CONECT    3    4   47   48
CONECT    4    5   49   50
CONECT    5    6    7    7
CONECT    6   51
CONECT    7    8
CONECT    8    9   34   52
CONECT    9   10   53   54
CONECT   10   11
CONECT   11   12   55   56
CONECT   12   13   13   14
CONECT   14   15
CONECT   15   16   57   58
CONECT   16   17   27   59
CONECT   17   18   18
CONECT   18   19   20
CONECT   19   60
CONECT   20   21   61   62
CONECT   21   22   63   64
CONECT   22   23   24   65
CONECT   23   66   67
CONECT   24   25   25   26
CONECT   26   68
CONECT   27   28   29   29
CONECT   28   69
CONECT   29   30
CONECT   30   31   70   71
CONECT   31   32   32   33
CONECT   33   72
CONECT   34   35   36   36
CONECT   35   73
CONECT   36   37
CONECT   37   38   74   75
CONECT   38   39   39   40
CONECT   40   76
CONECT   41   42   42   43
CONECT   43   77
END

HMDB0060343
     RDKit          3D
2-(S-Glutathionyl)acetyl glutathione
 77 76  0  0  0  0  0  0  0  0999 V2000
   -8.5130   -0.7040   -0.6577 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1741   -1.1243   -0.2478 C   0  0  1  0  0  0  0  0  0  0  0  0
   -6.2066   -0.5977   -1.2589 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7665   -0.9385   -0.9996 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9477   -0.3696   -2.0970 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2302   -0.7200   -3.3975 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9980    0.4275   -1.8627 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5501    0.9093   -0.5841 C   0  0  1  0  0  0  0  0  0  0  0  0
   -1.0920    1.3575   -0.7812 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4117    1.9920    0.7864 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2886    0.6805    2.0162 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6971   -0.3563    1.6332 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8757   -1.2984    2.3737 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6057   -0.2327    0.1215 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7254   -1.6508   -0.0996 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8203   -1.6856    0.9149 C   0  0  2  0  0  0  0  0  0  0  0  0
    4.6948   -0.5630    0.9339 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8953   -0.5276    0.4514 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3690   -1.6922   -0.1404 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7719    0.6295    0.4938 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2472    1.9620    0.1648 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7879    2.2589   -1.2094 C   0  0  2  0  0  0  0  0  0  0  0  0
    5.2960    3.6637   -1.2794 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6632    1.4315   -1.6410 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8109    0.2278   -1.9837 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3551    1.9337   -1.6977 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4995   -3.0051    0.8474 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5274   -3.3320    1.7174 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1502   -3.8842   -0.0247 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7768   -5.1658   -0.1244 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5278   -6.0282    1.0476 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0246   -7.1744    1.0816 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7590   -5.6062    2.1131 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3479    2.0588   -0.1277 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1036    2.6707    1.0800 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3042    2.5082   -0.8788 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1161    3.6321   -0.4789 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8853    4.8192   -1.3087 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0646    4.8033   -2.2428 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5914    5.9796   -1.0509 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9008   -0.5869    1.0886 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8542   -0.8963    1.6979 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8114    0.2863    1.7084 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8914   -1.4164   -1.3047 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4057    0.2116   -1.1248 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1230   -2.2470   -0.2310 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3502    0.5150   -1.3033 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4961   -0.9626   -2.2845 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4627   -0.4364   -0.0384 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5945   -2.0130   -0.8592 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5376   -1.6434   -3.6870 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5287    0.0719    0.1414 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0972    2.1527   -1.5293 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5390    0.4877   -1.1554 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0759    1.1530    2.9579 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2976    0.2591    2.2033 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0645   -2.5576    0.0453 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0424   -1.6750   -1.1445 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2922   -1.6763    1.9246 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9969   -2.0346   -1.0131 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7070    0.4659   -0.1118 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1450    0.6969    1.5716 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4830    2.3200    0.9347 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1033    2.6937    0.3672 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6213    2.2489   -1.9527 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6780    4.1924   -0.4715 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5674    4.1252   -2.1512 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0639    2.5853   -2.4108 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2547   -3.9587    1.4057 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4050   -5.7314   -1.0129 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8955   -5.0857   -0.2465 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7367   -5.6195    2.0910 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8030    3.6483    1.0552 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1823    3.3464   -0.5750 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9572    3.8556    0.6082 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3549    5.9973   -0.4022 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2342   -0.0615    2.5834 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  3
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  3
 18 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  2  0
 24 26  1  0
 16 27  1  0
 27 28  1  0
 27 29  2  3
 29 30  1  0
 30 31  1  0
 31 32  2  0
 31 33  1  0
  8 34  1  0
 34 35  1  0
 34 36  2  3
 36 37  1  0
 37 38  1  0
 38 39  2  0
 38 40  1  0
  2 41  1  0
 41 42  2  0
 41 43  1  0
  1 44  1  0
  1 45  1  0
  2 46  1  1
  3 47  1  0
  3 48  1  0
  4 49  1  0
  4 50  1  0
  6 51  1  0
  8 52  1  1
  9 53  1  0
  9 54  1  0
 11 55  1  0
 11 56  1  0
 15 57  1  0
 15 58  1  0
 16 59  1  1
 19 60  1  0
 20 61  1  0
 20 62  1  0
 21 63  1  0
 21 64  1  0
 22 65  1  6
 23 66  1  0
 23 67  1  0
 26 68  1  0
 28 69  1  0
 30 70  1  0
 30 71  1  0
 33 72  1  0
 35 73  1  0
 37 74  1  0
 37 75  1  0
 40 76  1  0
 43 77  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Not Available

Chemical Formula

C₂₂H₃₄N₆O₁₃S₂

Average Molecular Weight

654.668

Monoisotopic Molecular Weight

654.162526584

IUPAC Name

(2S)-2-amino-4-{[(1R)-2-[(2-{[(2R)-2-{[(4S)-4-amino-4-carboxy-1-hydroxybutylidene]amino}-2-[(carboxymethyl)-C-hydroxycarbonimidoyl]ethyl]sulfanyl}acetyl)sulfanyl]-1-[(carboxymethyl)-C-hydroxycarbonimidoyl]ethyl]-C-hydroxycarbonimidoyl}butanoic acid

Traditional Name

(2S)-2-amino-4-{[(1R)-2-[(2-{[(2R)-2-{[(4S)-4-amino-4-carboxy-1-hydroxybutylidene]amino}-2-(carboxymethyl-C-hydroxycarbonimidoyl)ethyl]sulfanyl}acetyl)sulfanyl]-1-(carboxymethyl-C-hydroxycarbonimidoyl)ethyl]-C-hydroxycarbonimidoyl}butanoic acid

CAS Registry Number

Not Available

SMILES

[H][C@](N)(CCC(O)=N[C@@]([H])(CSCC(=O)SC[C@]([H])(N=C(O)CC[C@]([H])(N)C(O)=O)C(O)=NCC(O)=O)C(O)=NCC(O)=O)C(O)=O

InChI Identifier

InChI=1S/C22H34N6O13S2/c23-10(21(38)39)1-3-14(29)27-12(19(36)25-5-16(31)32)7-42-9-18(35)43-8-13(20(37)26-6-17(33)34)28-15(30)4-2-11(24)22(40)41/h10-13H,1-9,23-24H2,(H,25,36)(H,26,37)(H,27,29)(H,28,30)(H,31,32)(H,33,34)(H,38,39)(H,40,41)/t10-,11-,12-,13-/m0/s1

InChI Key

QEJUVDVAWJBQIG-CYDGBPFRSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as oligopeptides. These are organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds.

Kingdom

Organic compounds

Super Class

Organic acids and derivatives

Class

Carboxylic acids and derivatives

Sub Class

Amino acids, peptides, and analogues

Direct Parent

Oligopeptides

Alternative Parents

Substituents

Alpha-oligopeptide
Gamma-glutamyl alpha peptide
S-acylglutathione
Glutamine or derivatives
N-acyl-alpha-amino acid
N-acyl-alpha amino acid or derivatives
Tetracarboxylic acid or derivatives
Alpha-amino acid amide
Cysteine or derivatives
Alpha-amino acid
N-substituted-alpha-amino acid
Alpha-amino acid or derivatives
L-alpha-amino acid
Fatty amide
N-acyl-amine
Fatty acyl
Thiocarboxylic acid ester
Carbothioic s-ester
Secondary carboxylic acid amide
Amino acid or derivatives
Carboxamide group
Amino acid
Thiocarboxylic acid or derivatives
Sulfenyl compound
Dialkylthioether
Thioether
Carboxylic acid
Primary amine
Primary aliphatic amine
Organic nitrogen compound
Hydrocarbon derivative
Organic oxygen compound
Carbonyl group
Organonitrogen compound
Amine
Organic oxide
Organopnictogen compound
Organooxygen compound
Organosulfur compound
Aliphatic acyclic compound

Molecular Framework

Aliphatic acyclic compounds

External Descriptors

peptide (CHEBI:34254 )

Ontology

Not Available

Exogenous (HMDB: HMDB0060343)

Process

Naturally occurring process

Biological process

Biochemical pathway

Metabolic pathway

Glutathione Metabolism III (PathBank: SMP0122217)

Role

Not Available

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.095 g/L	ALOGPS
logP	-3.2	ALOGPS
logP	-2.2	ChemAxon
logS	-3.8	ALOGPS
pKa (Strongest Acidic)	2.99	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	19	ChemAxon
Hydrogen Donor Count	10	ChemAxon
Polar Surface Area	348.67 Å²	ChemAxon
Rotatable Bond Count	23	ChemAxon
Refractivity	148.02 m³·mol⁻¹	ChemAxon
Polarizability	63.02 Å³	ChemAxon
Number of Rings	0	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	243.44	31661259
DarkChem	[M-H]-	233.779	31661259
DeepCCS	[M+H]+	240.876	30932474
DeepCCS	[M-H]-	238.981	30932474
DeepCCS	[M-2H]-	272.772	30932474
DeepCCS	[M+Na]+	246.675	30932474
AllCCS	[M+H]+	235.2	32859911
AllCCS	[M+H-H2O]+	234.7	32859911
AllCCS	[M+NH4]+	235.5	32859911
AllCCS	[M+Na]+	235.6	32859911
AllCCS	[M-H]-	222.6	32859911
AllCCS	[M+Na-2H]-	224.6	32859911
AllCCS	[M+HCOO]-	226.8	32859911

Predicted Retention Times

Underivatized

Chromatographic Method	Retention Time	Reference
Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022.	0.35 minutes	32390414
Predicted by Siyang on May 30, 2022	10.9231 minutes	33406817
Predicted by Siyang using ReTip algorithm on June 8, 2022	9.77 minutes	32390414
Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid	524.3 seconds	40023050
Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid	209.7 seconds	40023050
Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid	42.0 seconds	40023050
Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid	171.4 seconds	40023050
RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid	70.8 seconds	40023050
Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid	355.0 seconds	40023050
BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid	325.4 seconds	40023050
HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate)	1175.1 seconds	40023050
UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid	638.0 seconds	40023050
BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid	101.3 seconds	40023050
UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid	949.5 seconds	40023050
SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid	237.1 seconds	40023050
RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid	331.2 seconds	40023050
MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate	599.4 seconds	40023050
KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA	744.1 seconds	40023050
Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water	697.4 seconds	40023050

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
2-(S-Glutathionyl)acetyl glutathione	[H][C@](N)(CCC(O)=N[C@@]([H])(CSCC(=O)SC[C@]([H])(N=C(O)CC[C@]([H])(N)C(O)=O)C(O)=NCC(O)=O)C(O)=NCC(O)=O)C(O)=O	4947.7	Standard polar	33892256
2-(S-Glutathionyl)acetyl glutathione	[H][C@](N)(CCC(O)=N[C@@]([H])(CSCC(=O)SC[C@]([H])(N=C(O)CC[C@]([H])(N)C(O)=O)C(O)=NCC(O)=O)C(O)=NCC(O)=O)C(O)=O	4505.8	Standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione	[H][C@](N)(CCC(O)=N[C@@]([H])(CSCC(=O)SC[C@]([H])(N=C(O)CC[C@]([H])(N)C(O)=O)C(O)=NCC(O)=O)C(O)=NCC(O)=O)C(O)=O	5781.5	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
2-(S-Glutathionyl)acetyl glutathione,1TMS,isomer #1	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5354.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TMS,isomer #10	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5473.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TMS,isomer #2	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5356.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TMS,isomer #3	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5301.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TMS,isomer #4	C[Si](C)(C)OC(=NCC(=O)O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5308.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TMS,isomer #5	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5357.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TMS,isomer #6	C[Si](C)(C)OC(=NCC(=O)O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5305.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TMS,isomer #7	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5357.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TMS,isomer #8	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5301.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TMS,isomer #9	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5473.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #1	C[Si](C)(C)OC(=O)[C@@H](N)CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C	5126.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #10	C[Si](C)(C)OC(=O)[C@@H](N)CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C	5125.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #11	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5124.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #12	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O	5161.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #13	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5185.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #14	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C	5152.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #15	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C	5185.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #16	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5322.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #17	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5319.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #18	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5065.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #19	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O	5098.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #2	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5196.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #20	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5115.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #21	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C	5096.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #22	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C	5116.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #23	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O[Si](C)(C)C	5250.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #24	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5261.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #25	C[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5127.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #26	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O	5096.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #27	C[Si](C)(C)OC(=NCC(=O)O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	5133.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #28	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	5151.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #29	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5294.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #3	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5126.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #30	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5294.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #31	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5116.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #32	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	5154.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #33	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	5181.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #34	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5297.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #35	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O	5296.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #36	C[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5130.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #37	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C	5098.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #38	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5294.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #39	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5294.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #4	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O	5160.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #40	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C	5116.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #41	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5296.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #42	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O	5297.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #43	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O[Si](C)(C)C	5250.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #44	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5261.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #45	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N[Si](C)(C)C)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5428.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #46	C[Si](C)(C)N([C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O)[Si](C)(C)C	5463.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #47	C[Si](C)(C)N([C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O)[Si](C)(C)C	5463.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #5	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5188.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #6	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C	5152.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #7	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C	5188.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #8	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5322.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TMS,isomer #9	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5320.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #1	C[Si](C)(C)OC(=O)[C@@H](N)CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C	5016.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #10	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O	5026.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #100	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5118.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #101	C[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	4944.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #102	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5144.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #103	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5144.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #104	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5145.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #105	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O	5147.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #106	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N[Si](C)(C)C)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5296.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #107	C[Si](C)(C)OC(=NCC(=O)O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5283.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #108	C[Si](C)(C)OC(=NCC(=O)O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C	5281.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #109	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	4961.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #11	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C	5047.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #110	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C	4987.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #111	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O[Si](C)(C)C	5110.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #112	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O	5121.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #113	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	4977.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #114	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5148.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #115	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O	5149.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #116	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O	5160.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #117	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O	5160.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #118	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N[Si](C)(C)C)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5288.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #119	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5290.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #12	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O	5026.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #120	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C	5290.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #121	C[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C	4938.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #122	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5130.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #123	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O	5130.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #124	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	5097.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #125	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5120.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #126	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N[Si](C)(C)C)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5300.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #127	C[Si](C)(C)OC(=NCC(=O)O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5288.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #128	C[Si](C)(C)OC(=NCC(=O)O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C	5285.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #129	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5121.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #13	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C	5047.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #130	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	5110.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #131	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N[Si](C)(C)C)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O	5288.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #132	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5290.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #133	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C	5290.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #134	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5251.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #135	C[Si](C)(C)OC(=O)[C@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)N([Si](C)(C)C)[Si](C)(C)C	5260.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #136	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5254.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #137	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5436.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #138	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5437.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #14	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5204.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #15	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5204.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #16	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O	4974.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #17	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C	4991.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #18	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C	4979.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #19	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C	4991.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #2	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	4963.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #20	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O[Si](C)(C)C	5123.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #21	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5139.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #22	C[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C)[C@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	4971.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #23	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C	4988.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #24	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C	4999.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #25	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5164.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #26	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5170.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #27	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	4993.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #28	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	5037.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #29	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5174.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #3	C[Si](C)(C)OC(=O)[C@@H](N)CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)O[Si](C)(C)C	4978.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #30	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O	5176.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #31	C[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C	4968.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #32	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O	5160.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #33	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5164.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #34	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5176.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #35	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O	5174.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #36	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N[Si](C)(C)C)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5316.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #37	C[Si](C)(C)OC(CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5329.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #38	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5313.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #39	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	4963.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #4	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	4989.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #40	C[Si](C)(C)OC(=O)[C@@H](N)CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)O[Si](C)(C)C	4978.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #41	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	4989.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #42	C[Si](C)(C)OC(=O)[C@@H](N)CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)O[Si](C)(C)C	4972.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #43	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(CC[C@H](N)C(=O)O[Si](C)(C)C)O[Si](C)(C)C	4989.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #44	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	5130.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #45	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5137.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #46	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O	4974.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #47	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C	4991.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #48	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C	4979.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #49	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C	4991.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #5	C[Si](C)(C)OC(=O)[C@@H](N)CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)O[Si](C)(C)C	4972.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #50	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O[Si](C)(C)C	5121.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #51	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5138.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #52	C[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C)[C@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	4971.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #53	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C	4990.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #54	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C	4998.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #55	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5166.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #56	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5171.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #57	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	4993.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #58	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	5036.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #59	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5173.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #6	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(CC[C@H](N)C(=O)O[Si](C)(C)C)O[Si](C)(C)C	4989.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #60	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O	5174.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #61	C[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C	4968.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #62	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O	5159.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #63	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5162.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #64	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5174.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #65	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O	5172.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #66	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N[Si](C)(C)C)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5312.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #67	C[Si](C)(C)OC(CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5321.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #68	C[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5305.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #69	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O	4945.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #7	C[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	5131.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #70	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C	4946.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #71	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O	4945.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #72	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C	4946.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #73	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O[Si](C)(C)C	5081.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #74	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O[Si](C)(C)C	5081.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #75	C[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	4938.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #76	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C	4954.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #77	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C	4961.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #78	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O[Si](C)(C)C	5098.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #79	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=O)O	5120.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #8	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5139.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #80	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	4961.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #81	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	4987.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #82	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O[Si](C)(C)C	5110.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #83	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O	5121.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #84	C[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C	4937.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #85	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	5095.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #86	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5118.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #87	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5121.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #88	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	5109.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #89	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5251.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #9	C[Si](C)(C)OC(=O)[C@@H](N)CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C	5016.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #90	C[Si](C)(C)OC(=O)[C@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)N([Si](C)(C)C)[Si](C)(C)C	5261.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #91	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5253.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #92	C[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	4938.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #93	C[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	4944.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #94	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O	4976.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #95	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O	5128.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #96	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O	5127.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #97	C[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(=NCC(=O)O)O[Si](C)(C)C	4954.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #98	C[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C	4961.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,3TMS,isomer #99	C[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C)C(O)=NCC(=O)O)C(=O)O[Si](C)(C)C	5096.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5488.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5630.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5491.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5500.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC(=NCC(=O)O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5449.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5546.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC(=NCC(=O)O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5443.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5546.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5501.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5630.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C(C)(C)C	5470.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C(C)(C)C	5468.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5466.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O	5436.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5520.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C	5440.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C(C)(C)C	5520.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C(C)(C)C)C(=O)O	5622.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5618.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5476.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O	5433.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSCC(=O)SC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5487.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5514.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C	5437.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C	5514.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C	5601.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5609.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C(C)(C)C)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5473.0	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O	5437.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC(=NCC(=O)O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C)N=C(O)CC[C@H](N)C(=O)O	5411.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C)N=C(O)CC[C@H](N)C(=O)O	5483.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)C(=O)O	5589.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O	5468.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C)C(=O)O	5589.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5514.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C)N=C(O)CC[C@H](N)C(=O)O	5479.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C(C)(C)C)N=C(O)CC[C@H](N)C(=O)O	5568.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)C(=O)O	5644.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O	5643.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O[Si](C)(C)C(C)(C)C)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5469.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C	5433.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)C(=O)O	5584.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C)C(=O)O	5585.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O	5444.8	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C	5514.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)C(=O)O	5643.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O	5643.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C	5601.2	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5609.9	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5755.6	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #46	CC(C)(C)[Si](C)(C)N([C@@H](CCC(O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C	5720.7	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #47	CC(C)(C)[Si](C)(C)N([C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C	5720.5	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)N=C(O)CC[C@H](N)C(=O)O	5523.3	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC(CC[C@H](N)C(=O)O)=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(=NCC(=O)O)O[Si](C)(C)C(C)(C)C	5435.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC(=O)CN=C(O)[C@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C(C)(C)C	5524.4	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)N[C@@H](CCC(=N[C@@H](CSCC(=O)SC[C@H](N=C(O)CC[C@H](N)C(=O)O)C(O)=NCC(=O)O)C(O)=NCC(=O)O)O[Si](C)(C)C(C)(C)C)C(=O)O	5625.1	Semi standard non polar	33892256
2-(S-Glutathionyl)acetyl glutathione,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)N[C@@H](CCC(O)=N[C@@H](CSC(=O)CSC[C@H](N=C(CC[C@H](N)C(=O)O)O[Si](C)(C)C(C)(C)C)C(O)=NCC(=O)O)C(O)=NCC(=O)O)C(=O)O	5622.5	Semi standard non polar	33892256

Spectra

Biological Properties

Cellular Locations

Not Available

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

Not Available

KNApSAcK ID

Not Available

Chemspider ID

10128367

KEGG Compound ID

C14863

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

11954072

PDB ID

Not Available

ChEBI ID

34254

Food Biomarker Ontology

Not Available

VMH ID

M00566

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Magrane M: UniProt Knowledgebase: a hub of integrated protein data. Database (Oxford). 2011 Mar 29;2011:bar009. doi: 10.1093/database/bar009. Print 2011. [PubMed:21447597 ]

Only showing the first 10 proteins. There are 19 proteins in total.

Show all enzymes and transporters

Enzymes

Enzyme Details

1. Glutathione S-transferase Mu 2

General function:: Involved in glutathione transferase activity
Specific function:: Conjugation of reduced glutathione to a wide number of exogenous and endogenous hydrophobic electrophiles.
Gene Name:: GSTM2
Uniprot ID:: P28161
Molecular weight:: 25744.395

Reactions

2-(S-Glutathionyl)acetyl chloride + Glutathione → 2-(S-Glutathionyl)acetyl glutathione + Hydrochloric acid	details

Enzyme Details

2. Glutathione S-transferase Mu 1

General function:: Involved in glutathione transferase activity
Specific function:: Conjugation of reduced glutathione to a wide number of exogenous and endogenous hydrophobic electrophiles.
Gene Name:: GSTM1
Uniprot ID:: P09488
Molecular weight:: 25711.555

Reactions

2-(S-Glutathionyl)acetyl chloride + Glutathione → 2-(S-Glutathionyl)acetyl glutathione + Hydrochloric acid	details

Enzyme Details

3. Glutathione S-transferase kappa 1

General function:: Involved in protein disulfide oxidoreductase activity
Specific function:: Significant glutathione conjugating activity is found only with the model substrate, 1-chloro-2,4-dinitrobenzene (CDNB).
Gene Name:: GSTK1
Uniprot ID:: Q9Y2Q3
Molecular weight:: 31565.605

Reactions

2-(S-Glutathionyl)acetyl chloride + Glutathione → 2-(S-Glutathionyl)acetyl glutathione + Hydrochloric acid	details

Enzyme Details

4. Microsomal glutathione S-transferase 3

General function:: Involved in glutathione transferase activity
Specific function:: Also functions as a glutathione peroxidase.
Gene Name:: MGST3
Uniprot ID:: O14880
Molecular weight:: 16516.185

Reactions

2-(S-Glutathionyl)acetyl chloride + Glutathione → 2-(S-Glutathionyl)acetyl glutathione + Hydrochloric acid	details

Enzyme Details

5. Glutathione S-transferase Mu 3

General function:: Involved in glutathione transferase activity
Specific function:: Conjugation of reduced glutathione to a wide number of exogenous and endogenous hydrophobic electrophiles. May govern uptake and detoxification of both endogenous compounds and xenobiotics at the testis and brain blood barriers.
Gene Name:: GSTM3
Uniprot ID:: P21266
Molecular weight:: 26559.32

Reactions

2-(S-Glutathionyl)acetyl chloride + Glutathione → 2-(S-Glutathionyl)acetyl glutathione + Hydrochloric acid	details

Enzyme Details

6. Glutathione S-transferase A1

General function:: Involved in glutathione transferase activity
Specific function:: Conjugation of reduced glutathione to a wide number of exogenous and endogenous hydrophobic electrophiles.
Gene Name:: GSTA1
Uniprot ID:: P08263
Molecular weight:: 25630.785

Reactions

2-(S-Glutathionyl)acetyl chloride + Glutathione → 2-(S-Glutathionyl)acetyl glutathione + Hydrochloric acid	details

Enzyme Details

7. Microsomal glutathione S-transferase 1

General function:: Involved in glutathione transferase activity
Specific function:: Conjugation of reduced glutathione to a wide number of exogenous and endogenous hydrophobic electrophiles. Has a wide substrate specificity.
Gene Name:: MGST1
Uniprot ID:: P10620
Molecular weight:: 17598.45

Reactions

2-(S-Glutathionyl)acetyl chloride + Glutathione → 2-(S-Glutathionyl)acetyl glutathione + Hydrochloric acid	details

Enzyme Details

8. Glutathione S-transferase Mu 4

General function:: Involved in glutathione transferase activity
Specific function:: Conjugation of reduced glutathione to a wide number of exogenous and endogenous hydrophobic electrophiles. Active on 1-chloro-2,4-dinitrobenzene.
Gene Name:: GSTM4
Uniprot ID:: Q03013
Molecular weight:: 25561.095

Reactions

2-(S-Glutathionyl)acetyl chloride + Glutathione → 2-(S-Glutathionyl)acetyl glutathione + Hydrochloric acid	details

Enzyme Details

9. Glutathione S-transferase Mu 5

General function:: Involved in glutathione transferase activity
Specific function:: Conjugation of reduced glutathione to a wide number of exogenous and endogenous hydrophobic electrophiles.
Gene Name:: GSTM5
Uniprot ID:: P46439
Molecular weight:: 25674.455

Reactions

2-(S-Glutathionyl)acetyl chloride + Glutathione → 2-(S-Glutathionyl)acetyl glutathione + Hydrochloric acid	details

Enzyme Details

10. Microsomal glutathione S-transferase 2

General function:: Involved in enzyme activator activity
Specific function:: Can catalyze the production of LTC4 from LTA4 and reduced glutathione. Can catalyze the conjugation of 1-chloro-2,4-dinitrobenzene with reduced glutathione.
Gene Name:: MGST2
Uniprot ID:: Q99735
Molecular weight:: 16620.4

Reactions

2-(S-Glutathionyl)acetyl chloride + Glutathione → 2-(S-Glutathionyl)acetyl glutathione + Hydrochloric acid	details

Only showing the first 10 proteins. There are 19 proteins in total.

Show all enzymes and transporters

Showing metabocard for 2-(S-Glutathionyl)acetyl glutathione (HMDB0060343)

MOL for HMDB0060343 (2-(S-Glutathionyl)acetyl glutathione)

3D MOL for HMDB0060343 (2-(S-Glutathionyl)acetyl glutathione)

3D SDF for HMDB0060343 (2-(S-Glutathionyl)acetyl glutathione)

3D-SDF for HMDB0060343 (2-(S-Glutathionyl)acetyl glutathione)

PDB for HMDB0060343 (2-(S-Glutathionyl)acetyl glutathione)

3D PDB for HMDB0060343 (2-(S-Glutathionyl)acetyl glutathione)

SMILES for HMDB0060343 (2-(S-Glutathionyl)acetyl glutathione)

INCHI for HMDB0060343 (2-(S-Glutathionyl)acetyl glutathione)

Structure for HMDB0060343 (2-(S-Glutathionyl)acetyl glutathione)

3D Structure for HMDB0060343 (2-(S-Glutathionyl)acetyl glutathione)

Predicted Collision Cross Sections

Predicted Retention Times

Underivatized

Predicted Kovats Retention Indices

Underivatized

Derivatized

Enzymes

Reactions

Reactions

Reactions

Reactions

Reactions

Reactions

Reactions

Reactions

Reactions

Reactions