Chromatographic Method | Retention Time | Reference |
---|
Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 2.96 minutes | 32390414 |
Predicted by Siyang on May 30, 2022 | 10.2394 minutes | 33406817 |
Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.67 minutes | 32390414 |
AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 148.5 seconds | 40023050 |
Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1463.4 seconds | 40023050 |
Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 206.0 seconds | 40023050 |
Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 98.6 seconds | 40023050 |
Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 176.3 seconds | 40023050 |
RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 66.3 seconds | 40023050 |
Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 282.2 seconds | 40023050 |
BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 359.9 seconds | 40023050 |
HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 304.4 seconds | 40023050 |
UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 666.8 seconds | 40023050 |
BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 259.7 seconds | 40023050 |
UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 921.3 seconds | 40023050 |
SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 218.9 seconds | 40023050 |
RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 233.8 seconds | 40023050 |
MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 359.5 seconds | 40023050 |
KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 271.0 seconds | 40023050 |
Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 67.0 seconds | 40023050 |
Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
(-)-erythro-Anethole glycol 1-glucoside,1TMS,isomer #1 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(C)O)C=C1 | 2909.5 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,1TMS,isomer #2 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(C)O)C=C1 | 2879.2 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,1TMS,isomer #3 | COC1=CC=C(C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(C)O)C=C1 | 2871.9 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,1TMS,isomer #4 | COC1=CC=C(C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(C)O)C=C1 | 2878.9 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,1TMS,isomer #5 | COC1=CC=C(C(OC2OC(CO)C(O)C(O)C2O)C(C)O[Si](C)(C)C)C=C1 | 2942.8 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TMS,isomer #1 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(C)O)C=C1 | 2826.8 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TMS,isomer #10 | COC1=CC=C(C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(C)O[Si](C)(C)C)C=C1 | 2829.1 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TMS,isomer #2 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(C)O)C=C1 | 2830.3 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TMS,isomer #3 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(C)O)C=C1 | 2821.3 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TMS,isomer #4 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(C)O[Si](C)(C)C)C=C1 | 2838.8 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TMS,isomer #5 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(C)O)C=C1 | 2817.7 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TMS,isomer #6 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(C)O)C=C1 | 2812.0 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TMS,isomer #7 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(C)O[Si](C)(C)C)C=C1 | 2831.9 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TMS,isomer #8 | COC1=CC=C(C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)O)C=C1 | 2822.7 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TMS,isomer #9 | COC1=CC=C(C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(C)O[Si](C)(C)C)C=C1 | 2826.8 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TMS,isomer #1 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(C)O)C=C1 | 2766.5 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TMS,isomer #10 | COC1=CC=C(C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)O[Si](C)(C)C)C=C1 | 2759.9 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TMS,isomer #2 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(C)O)C=C1 | 2782.8 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TMS,isomer #3 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(C)O[Si](C)(C)C)C=C1 | 2772.6 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TMS,isomer #4 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)O)C=C1 | 2755.1 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TMS,isomer #5 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(C)O[Si](C)(C)C)C=C1 | 2757.4 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TMS,isomer #6 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(C)O[Si](C)(C)C)C=C1 | 2767.3 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TMS,isomer #7 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)O)C=C1 | 2774.3 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TMS,isomer #8 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(C)O[Si](C)(C)C)C=C1 | 2763.7 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TMS,isomer #9 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(C)O[Si](C)(C)C)C=C1 | 2779.2 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,4TMS,isomer #1 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)O)C=C1 | 2723.8 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,4TMS,isomer #2 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(C)O[Si](C)(C)C)C=C1 | 2718.5 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,4TMS,isomer #3 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(C)O[Si](C)(C)C)C=C1 | 2737.3 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,4TMS,isomer #4 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)O[Si](C)(C)C)C=C1 | 2691.8 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,4TMS,isomer #5 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)O[Si](C)(C)C)C=C1 | 2707.4 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,5TMS,isomer #1 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)O[Si](C)(C)C)C=C1 | 2697.4 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,1TBDMS,isomer #1 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(C)O)C=C1 | 3140.5 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,1TBDMS,isomer #2 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(C)O)C=C1 | 3149.3 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,1TBDMS,isomer #3 | COC1=CC=C(C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)O)C=C1 | 3139.4 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,1TBDMS,isomer #4 | COC1=CC=C(C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)O)C=C1 | 3144.2 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,1TBDMS,isomer #5 | COC1=CC=C(C(OC2OC(CO)C(O)C(O)C2O)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3189.4 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TBDMS,isomer #1 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(C)O)C=C1 | 3309.5 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TBDMS,isomer #10 | COC1=CC=C(C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3333.7 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TBDMS,isomer #2 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)O)C=C1 | 3312.7 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TBDMS,isomer #3 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)O)C=C1 | 3299.5 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TBDMS,isomer #4 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3320.9 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TBDMS,isomer #5 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)O)C=C1 | 3324.4 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TBDMS,isomer #6 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)O)C=C1 | 3314.8 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TBDMS,isomer #7 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3339.5 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TBDMS,isomer #8 | COC1=CC=C(C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(C)O)C=C1 | 3321.9 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,2TBDMS,isomer #9 | COC1=CC=C(C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3334.2 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TBDMS,isomer #1 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)O)C=C1 | 3491.9 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TBDMS,isomer #10 | COC1=CC=C(C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3487.7 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TBDMS,isomer #2 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)O)C=C1 | 3490.4 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TBDMS,isomer #3 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3488.2 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TBDMS,isomer #4 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(C)O)C=C1 | 3479.2 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TBDMS,isomer #5 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3480.3 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TBDMS,isomer #6 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3481.1 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TBDMS,isomer #7 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(C)O)C=C1 | 3470.2 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TBDMS,isomer #8 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3481.7 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,3TBDMS,isomer #9 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3485.5 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,4TBDMS,isomer #1 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(C)O)C=C1 | 3630.5 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,4TBDMS,isomer #2 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3636.3 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,4TBDMS,isomer #3 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3652.3 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,4TBDMS,isomer #4 | COC1=CC=C(C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3633.4 | Semi standard non polar | 33892256 |
(-)-erythro-Anethole glycol 1-glucoside,4TBDMS,isomer #5 | COC1=CC=C(C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(C)O[Si](C)(C)C(C)(C)C)C=C1 | 3620.2 | Semi standard non polar | 33892256 |