| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 2.22 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 10.2228 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 7.49 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 278.2 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 881.9 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 217.6 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 89.8 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 167.3 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 70.9 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 276.6 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 306.6 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 713.3 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 672.6 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 262.4 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 803.6 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 179.7 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 228.3 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 382.6 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 431.2 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 158.2 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Threonylphenylalanine,1TMS,isomer #1 | C[C@@H](O[Si](C)(C)C)[C@H](N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O | 2283.4 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,1TMS,isomer #2 | C[C@@H](O)[C@H](N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C | 2232.1 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,1TMS,isomer #3 | C[C@@H](O)[C@H](N[Si](C)(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O | 2285.4 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,1TMS,isomer #4 | C[C@@H](O)[C@H](N)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C | 2248.8 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TMS,isomer #1 | C[C@@H](O[Si](C)(C)C)[C@H](N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C | 2250.7 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TMS,isomer #2 | C[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O | 2298.3 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TMS,isomer #3 | C[C@@H](O[Si](C)(C)C)[C@H](N)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C | 2272.4 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TMS,isomer #4 | C[C@@H](O)[C@H](N[Si](C)(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C | 2270.4 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TMS,isomer #5 | C[C@@H](O)[C@H](N)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2214.8 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TMS,isomer #6 | C[C@@H](O)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2423.6 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TMS,isomer #7 | C[C@@H](O)[C@H](N[Si](C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C | 2296.0 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #1 | C[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C | 2294.0 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #1 | C[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C | 2322.9 | Standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #2 | C[C@@H](O[Si](C)(C)C)[C@H](N)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2246.7 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #2 | C[C@@H](O[Si](C)(C)C)[C@H](N)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2363.2 | Standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #3 | C[C@@H](O[Si](C)(C)C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2425.0 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #3 | C[C@@H](O[Si](C)(C)C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2406.6 | Standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #4 | C[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C | 2293.6 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #4 | C[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C | 2378.1 | Standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #5 | C[C@@H](O)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2399.1 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #5 | C[C@@H](O)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2405.0 | Standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #6 | C[C@@H](O)[C@H](N[Si](C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2257.1 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #6 | C[C@@H](O)[C@H](N[Si](C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2339.0 | Standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #7 | C[C@@H](O)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2398.7 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TMS,isomer #7 | C[C@@H](O)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2462.7 | Standard non polar | 33892256 |
| Threonylphenylalanine,4TMS,isomer #1 | C[C@@H](O[Si](C)(C)C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2434.0 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,4TMS,isomer #1 | C[C@@H](O[Si](C)(C)C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2449.6 | Standard non polar | 33892256 |
| Threonylphenylalanine,4TMS,isomer #2 | C[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2289.1 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,4TMS,isomer #2 | C[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2401.3 | Standard non polar | 33892256 |
| Threonylphenylalanine,4TMS,isomer #3 | C[C@@H](O[Si](C)(C)C)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2450.6 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,4TMS,isomer #3 | C[C@@H](O[Si](C)(C)C)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2506.8 | Standard non polar | 33892256 |
| Threonylphenylalanine,4TMS,isomer #4 | C[C@@H](O)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2433.3 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,4TMS,isomer #4 | C[C@@H](O)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2492.1 | Standard non polar | 33892256 |
| Threonylphenylalanine,5TMS,isomer #1 | C[C@@H](O[Si](C)(C)C)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2516.5 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,5TMS,isomer #1 | C[C@@H](O[Si](C)(C)C)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2535.2 | Standard non polar | 33892256 |
| Threonylphenylalanine,1TBDMS,isomer #1 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O | 2521.4 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,1TBDMS,isomer #2 | C[C@@H](O)[C@H](N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C | 2496.2 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,1TBDMS,isomer #3 | C[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O | 2511.5 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,1TBDMS,isomer #4 | C[C@@H](O)[C@H](N)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C(C)(C)C | 2490.5 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TBDMS,isomer #1 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C | 2731.7 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TBDMS,isomer #2 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O | 2750.1 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TBDMS,isomer #3 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C(C)(C)C | 2754.3 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TBDMS,isomer #4 | C[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C | 2723.8 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TBDMS,isomer #5 | C[C@@H](O)[C@H](N)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2712.6 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TBDMS,isomer #6 | C[C@@H](O)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2857.3 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,2TBDMS,isomer #7 | C[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C(C)(C)C | 2758.0 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #1 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C | 2928.3 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #1 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C | 2887.5 | Standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #2 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2961.5 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #2 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2929.5 | Standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #3 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3130.0 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #3 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2939.8 | Standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #4 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C(C)(C)C | 2984.3 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #4 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C(C)(C)C | 2924.0 | Standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #5 | C[C@@H](O)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3084.3 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #5 | C[C@@H](O)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2947.2 | Standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #6 | C[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2948.7 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #6 | C[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2917.1 | Standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #7 | C[C@@H](O)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3082.2 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,3TBDMS,isomer #7 | C[C@@H](O)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2984.2 | Standard non polar | 33892256 |
| Threonylphenylalanine,4TBDMS,isomer #1 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3326.9 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,4TBDMS,isomer #1 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3121.5 | Standard non polar | 33892256 |
| Threonylphenylalanine,4TBDMS,isomer #2 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3150.1 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,4TBDMS,isomer #2 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3105.5 | Standard non polar | 33892256 |
| Threonylphenylalanine,4TBDMS,isomer #3 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3329.5 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,4TBDMS,isomer #3 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3176.0 | Standard non polar | 33892256 |
| Threonylphenylalanine,4TBDMS,isomer #4 | C[C@@H](O)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3274.4 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,4TBDMS,isomer #4 | C[C@@H](O)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3196.6 | Standard non polar | 33892256 |
| Threonylphenylalanine,5TBDMS,isomer #1 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3521.1 | Semi standard non polar | 33892256 |
| Threonylphenylalanine,5TBDMS,isomer #1 | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)N([C@@H](CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3362.9 | Standard non polar | 33892256 |