| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.34 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 8.4831 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 6.72 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 317.0 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 468.1 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 292.3 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 59.9 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 181.5 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 53.8 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 247.7 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 227.6 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 792.1 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 556.2 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 36.0 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 623.1 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 182.6 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 193.4 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 749.2 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 502.9 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 325.7 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 5-Amino-2-oxopentanoic acid,1TMS,isomer #1 | C[Si](C)(C)OC(=O)C(=O)CCCN | 1324.8 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,1TMS,isomer #2 | C[Si](C)(C)OC(=CCCN)C(=O)O | 1430.0 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,1TMS,isomer #3 | C[Si](C)(C)NCCCC(=O)C(=O)O | 1451.8 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TMS,isomer #1 | C[Si](C)(C)OC(=O)C(=CCCN)O[Si](C)(C)C | 1479.6 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TMS,isomer #1 | C[Si](C)(C)OC(=O)C(=CCCN)O[Si](C)(C)C | 1483.8 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TMS,isomer #1 | C[Si](C)(C)OC(=O)C(=CCCN)O[Si](C)(C)C | 2015.7 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TMS,isomer #2 | C[Si](C)(C)NCCCC(=O)C(=O)O[Si](C)(C)C | 1502.3 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TMS,isomer #2 | C[Si](C)(C)NCCCC(=O)C(=O)O[Si](C)(C)C | 1562.2 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TMS,isomer #2 | C[Si](C)(C)NCCCC(=O)C(=O)O[Si](C)(C)C | 1692.5 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TMS,isomer #3 | C[Si](C)(C)NCCC=C(O[Si](C)(C)C)C(=O)O | 1619.3 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TMS,isomer #3 | C[Si](C)(C)NCCC=C(O[Si](C)(C)C)C(=O)O | 1679.7 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TMS,isomer #3 | C[Si](C)(C)NCCC=C(O[Si](C)(C)C)C(=O)O | 1891.6 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TMS,isomer #4 | C[Si](C)(C)N(CCCC(=O)C(=O)O)[Si](C)(C)C | 1692.9 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TMS,isomer #4 | C[Si](C)(C)N(CCCC(=O)C(=O)O)[Si](C)(C)C | 1610.3 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TMS,isomer #4 | C[Si](C)(C)N(CCCC(=O)C(=O)O)[Si](C)(C)C | 1993.2 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TMS,isomer #1 | C[Si](C)(C)NCCC=C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1630.9 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TMS,isomer #1 | C[Si](C)(C)NCCC=C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1658.8 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TMS,isomer #1 | C[Si](C)(C)NCCC=C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1646.2 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(=O)CCCN([Si](C)(C)C)[Si](C)(C)C | 1737.4 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(=O)CCCN([Si](C)(C)C)[Si](C)(C)C | 1657.3 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(=O)CCCN([Si](C)(C)C)[Si](C)(C)C | 1673.6 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TMS,isomer #3 | C[Si](C)(C)OC(=CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 1813.5 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TMS,isomer #3 | C[Si](C)(C)OC(=CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 1779.6 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TMS,isomer #3 | C[Si](C)(C)OC(=CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 1842.6 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,4TMS,isomer #1 | C[Si](C)(C)OC(=O)C(=CCCN([Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C | 1786.2 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,4TMS,isomer #1 | C[Si](C)(C)OC(=O)C(=CCCN([Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C | 1750.2 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,4TMS,isomer #1 | C[Si](C)(C)OC(=O)C(=CCCN([Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C | 1623.7 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(=O)CCCN | 1565.4 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=CCCN)C(=O)O | 1674.3 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NCCCC(=O)C(=O)O | 1720.0 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(=CCCN)O[Si](C)(C)C(C)(C)C | 1953.2 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(=CCCN)O[Si](C)(C)C(C)(C)C | 1848.4 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(=CCCN)O[Si](C)(C)C(C)(C)C | 2119.9 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCC(=O)C(=O)O[Si](C)(C)C(C)(C)C | 1979.2 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCC(=O)C(=O)O[Si](C)(C)C(C)(C)C | 1931.7 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCC(=O)C(=O)O[Si](C)(C)C(C)(C)C | 1940.5 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NCCC=C(O[Si](C)(C)C(C)(C)C)C(=O)O | 2074.9 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NCCC=C(O[Si](C)(C)C(C)(C)C)C(=O)O | 2023.5 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NCCC=C(O[Si](C)(C)C(C)(C)C)C(=O)O | 2066.6 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(CCCC(=O)C(=O)O)[Si](C)(C)C(C)(C)C | 2142.2 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(CCCC(=O)C(=O)O)[Si](C)(C)C(C)(C)C | 2015.9 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(CCCC(=O)C(=O)O)[Si](C)(C)C(C)(C)C | 2092.5 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCCC=C(O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2274.0 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCCC=C(O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2155.3 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCCC=C(O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2045.0 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(=O)CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2378.5 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(=O)CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2253.2 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(=O)CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2055.3 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2447.1 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2309.0 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2151.2 | Standard polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(=CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2640.8 | Semi standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(=CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2420.8 | Standard non polar | 33892256 |
| 5-Amino-2-oxopentanoic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(=CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2110.0 | Standard polar | 33892256 |