| Record Information | 
|---|
| Version | 5.0 | 
|---|
| Status | Detected but not Quantified | 
|---|
| Creation Date | 2006-05-22 14:17:55 UTC | 
|---|
| Update Date | 2023-02-21 17:16:25 UTC | 
|---|
| HMDB ID | HMDB0002520 | 
|---|
| Secondary Accession Numbers |  | 
|---|
| Metabolite Identification | 
|---|
| Common Name | beta-Glycerophosphoric acid | 
|---|
| Description | beta-Glycerophosphoric acid, also known as b-glycerophosphate, belongs to the class of organic compounds known as glycerophosphates. Glycerophosphates are compounds containing a glycerol linked to a phosphate group. Based on a literature review a significant number of articles have been published on beta-Glycerophosphoric acid. | 
|---|
| Structure | InChI=1S/C3H9O6P/c4-1-3(2-5)9-10(6,7)8/h3-5H,1-2H2,(H2,6,7,8)  | 
|---|
| Synonyms | | Value | Source | 
|---|
 | 1,2,3-Propanetriol, 2-(dihydrogen phosphate) | ChEBI |  | 1,3-Hydroxy-2-propyl dihydrogen phosphate | ChEBI |  | 2-Glycerophosphate | ChEBI |  | 2-HYDROXY-1-(hydroxymethyl)ethyl dihydrogen phosphATE | ChEBI |  | beta-Glycerophosphate | ChEBI |  | 1,2,3-Propanetriol, 2-(dihydrogen phosphoric acid) | Generator |  | 1,3-Hydroxy-2-propyl dihydrogen phosphoric acid | Generator |  | 2-Glycerophosphoric acid | Generator |  | 2-HYDROXY-1-(hydroxymethyl)ethyl dihydrogen phosphoric acid | Generator |  | b-Glycerophosphate | Generator |  | b-Glycerophosphoric acid | Generator |  | Β-glycerophosphate | Generator |  | Β-glycerophosphoric acid | Generator |  | Glycerol 2-phosphate | MeSH |  | beta-Glycerol phosphate | MeSH |  | beta-Glycerophosphoric acid, calcium salt | MeSH |  | beta-Glycerophosphoric acid, calcium salt (1:1) | MeSH |  | beta-Glycerophosphoric acid, disodium salt | MeSH |  | beta-Glycerophosphoric acid, iron salt | MeSH |  | beta-Glycerophosphoric acid, iron(3+) salt(3:2) | MeSH |  | beta-Glycerophosphoric acid, sodium salt | MeSH |  | beta-Glycerophosphorate | HMDB |  | Glycerol-2-phosphate | HMDB |  | beta-Glycerophosphoric acid | ChEBI |  | Glycerol 2-phosphoric acid | Generator, HMDB |  | BGA | HMDB |  | Dihydrogen beta-glycerophosphate | HMDB |  | Dihydrogen β-glycerophosphate | HMDB |  | beta-Glyceryl phosphate | HMDB |  | β-Glyceryl phosphate | HMDB |  | Glycerol-2-phosphoric acid | Generator |  
  | 
|---|
| Chemical Formula | C3H9O6P | 
|---|
| Average Molecular Weight | 172.0737 | 
|---|
| Monoisotopic Molecular Weight | 172.013674532 | 
|---|
| IUPAC Name | [(1,3-dihydroxypropan-2-yl)oxy]phosphonic acid | 
|---|
| Traditional Name | β-glycerophosphorate | 
|---|
| CAS Registry Number | 17181-54-3 | 
|---|
| SMILES | OCC(CO)OP(O)(O)=O  | 
|---|
| InChI Identifier | InChI=1S/C3H9O6P/c4-1-3(2-5)9-10(6,7)8/h3-5H,1-2H2,(H2,6,7,8)  | 
|---|
| InChI Key | DHCLVCXQIBBOPH-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Description |  Belongs to the class of organic compounds known as glycerophosphates. Glycerophosphates are compounds containing a glycerol linked to a phosphate group. | 
|---|
| Kingdom | Organic compounds   | 
|---|
| Super Class | Lipids and lipid-like molecules   | 
|---|
| Class | Glycerophospholipids   | 
|---|
| Sub Class | Glycerophosphates   | 
|---|
| Direct Parent | Glycerophosphates   | 
|---|
| Alternative Parents |  | 
|---|
| Substituents | - Sn-glycerol-2-phosphate
 
- Monoalkyl phosphate
 
- Alkyl phosphate
 
- Phosphoric acid ester
 
- Organic phosphoric acid derivative
 
- Organic oxygen compound
 
- Organic oxide
 
- Hydrocarbon derivative
 
- Primary alcohol
 
- Organooxygen compound
 
- Alcohol
 
- Aliphatic acyclic compound
 
  | 
|---|
| Molecular Framework | Aliphatic acyclic compounds | 
|---|
| External Descriptors |  | 
|---|
| Ontology | 
|---|
| Physiological effect |  | 
|---|
| Disposition |  | 
|---|
| Process |  | 
|---|
| Role |  | 
|---|
| Physical Properties | 
|---|
| State | Solid | 
|---|
| Experimental Molecular Properties | | Property | Value | Reference | 
|---|
 | Melting Point | Not Available | Not Available |  | Boiling Point | Not Available | Not Available |  | Water Solubility | Not Available | Not Available |  | LogP | Not Available | Not Available |  
  | 
|---|
| Experimental Chromatographic Properties | Experimental Collision Cross Sections | 
|---|
| Predicted Molecular Properties |  | 
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference | 
|---|
 | Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.36 minutes | 32390414   |  | Predicted by Siyang on May 30, 2022 | 9.1208 minutes | 33406817   |  | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 9.04 minutes | 32390414   |  | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 410.1 seconds | 40023050   |  | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 460.9 seconds | 40023050   |  | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 323.2 seconds | 40023050   |  | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 37.0 seconds | 40023050   |  | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 208.8 seconds | 40023050   |  | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 75.9 seconds | 40023050   |  | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 297.7 seconds | 40023050   |  | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 221.0 seconds | 40023050   |  | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 816.3 seconds | 40023050   |  | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 572.9 seconds | 40023050   |  | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 41.5 seconds | 40023050   |  | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 656.8 seconds | 40023050   |  | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 202.8 seconds | 40023050   |  | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 326.7 seconds | 40023050   |  | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 752.9 seconds | 40023050   |  | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 386.0 seconds | 40023050   |  | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 435.3 seconds | 40023050   |  
 Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference | 
|---|
 | beta-Glycerophosphoric acid,1TMS,isomer #1 | C[Si](C)(C)OCC(CO)OP(=O)(O)O | 1683.8 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,1TMS,isomer #2 | C[Si](C)(C)OP(=O)(O)OC(CO)CO | 1660.6 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,2TMS,isomer #1 | C[Si](C)(C)OCC(CO[Si](C)(C)C)OP(=O)(O)O | 1721.3 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,2TMS,isomer #2 | C[Si](C)(C)OCC(CO)OP(=O)(O)O[Si](C)(C)C | 1709.3 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,2TMS,isomer #3 | C[Si](C)(C)OP(=O)(OC(CO)CO)O[Si](C)(C)C | 1676.8 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,3TMS,isomer #1 | C[Si](C)(C)OCC(CO[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 1727.1 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,3TMS,isomer #1 | C[Si](C)(C)OCC(CO[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 1682.4 | Standard non polar | 33892256   |  | beta-Glycerophosphoric acid,3TMS,isomer #1 | C[Si](C)(C)OCC(CO[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 1983.4 | Standard polar | 33892256   |  | beta-Glycerophosphoric acid,3TMS,isomer #2 | C[Si](C)(C)OCC(CO)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1712.3 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,3TMS,isomer #2 | C[Si](C)(C)OCC(CO)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1698.9 | Standard non polar | 33892256   |  | beta-Glycerophosphoric acid,3TMS,isomer #2 | C[Si](C)(C)OCC(CO)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1850.1 | Standard polar | 33892256   |  | beta-Glycerophosphoric acid,4TMS,isomer #1 | C[Si](C)(C)OCC(CO[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1720.8 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,4TMS,isomer #1 | C[Si](C)(C)OCC(CO[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1728.4 | Standard non polar | 33892256   |  | beta-Glycerophosphoric acid,4TMS,isomer #1 | C[Si](C)(C)OCC(CO[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1783.8 | Standard polar | 33892256   |  | beta-Glycerophosphoric acid,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC(CO)OP(=O)(O)O | 1935.0 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O)OC(CO)CO | 1901.9 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC(CO[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 2140.9 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OCC(CO)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 2127.2 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(OC(CO)CO)O[Si](C)(C)C(C)(C)C | 2112.2 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC(CO[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 2360.0 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC(CO[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 2298.3 | Standard non polar | 33892256   |  | beta-Glycerophosphoric acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC(CO[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 2315.2 | Standard polar | 33892256   |  | beta-Glycerophosphoric acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OCC(CO)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2345.4 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OCC(CO)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2257.3 | Standard non polar | 33892256   |  | beta-Glycerophosphoric acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OCC(CO)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2196.9 | Standard polar | 33892256   |  | beta-Glycerophosphoric acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC(CO[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2579.7 | Semi standard non polar | 33892256   |  | beta-Glycerophosphoric acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC(CO[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2438.4 | Standard non polar | 33892256   |  | beta-Glycerophosphoric acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC(CO[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2232.6 | Standard polar | 33892256   |  
  | 
|---|