| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected and Quantified |
|---|
| Creation Date | 2006-05-22 14:17:39 UTC |
|---|
| Update Date | 2022-03-07 02:49:13 UTC |
|---|
| HMDB ID | HMDB0002163 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Trihydroxycoprostanoic acid |
|---|
| Description | Trihydroxycoprostanoic acid is excreted in the urine of patients with Zellweger syndrome (PMID 7347441 ), a genetic disorder. The oxidation trihydroxycoprostanic acid is deficient in liver homogenates from patients with peroxisomal diseases (PMID 2576087 ). Trihydroxycoprostanoic acid is found to be associated with adrenoleukodystrophy (ALD), which is also an inborn error of metabolism. |
|---|
| Structure | [H][C@@]12CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])[C@H](O)C[C@@]2(C[C@H](O)CC[C@]12C)C(O)=O InChI=1S/C28H48O5/c1-16(2)7-6-8-17(3)19-9-10-20-24-21(13-23(31)27(19,20)5)26(4)12-11-18(29)14-28(26,25(32)33)15-22(24)30/h16-24,29-31H,6-15H2,1-5H3,(H,32,33)/t17-,18-,19-,20+,21+,22-,23+,24+,26-,27-,28+/m1/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| Trihydroxycoprostanoate | Generator | | 3 alpha,7 alpha,12 alpha-Trihydroxycoprostanic acid | MeSH | | 3,7,12-Trihydroxycoprostanic acid | MeSH | | 3 alpha,7 alpha,12 alpha-Trihydroxy-5 beta-cholestanoic acid | MeSH | | (3a,5b,7a,12a)-3,7,12-Trihydroxy-cholestane-5-carboxylate | HMDB | | (3a,5b,7a,12a)-3,7,12-Trihydroxy-cholestane-5-carboxylic acid | HMDB | | (3alpha,5beta,7alpha,12alpha)-3,7,12-Trihydroxycholestane-5-carboxylate | HMDB | | (3alpha,5beta,7alpha,12alpha)-3,7,12-Trihydroxycholestane-5-carboxylic acid | HMDB | | 3,7,12-Trihydroxycoprostanate | HMDB | | 3alpha,7alpha,12alpha-Trihydroxycoprostanate | HMDB | | 3alpha,7alpha,12alpha-Trihydroxycoprostanic acid | HMDB | | 5-Thca | HMDB, MeSH | | Tryhydroxycoprostanate | HMDB | | Tryhydroxycoprostanic acid | HMDB | | (1S,2R,5R,7R,9R,10R,11S,14R,15R,16S)-5,9,16-Trihydroxy-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecane-7-carboxylate | Generator, HMDB |
|
|---|
| Chemical Formula | C28H48O5 |
|---|
| Average Molecular Weight | 464.6777 |
|---|
| Monoisotopic Molecular Weight | 464.350174646 |
|---|
| IUPAC Name | (1S,2R,5R,7R,9R,10R,11S,14R,15R,16S)-5,9,16-trihydroxy-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecane-7-carboxylic acid |
|---|
| Traditional Name | (1S,2R,5R,7R,9R,10R,11S,14R,15R,16S)-5,9,16-trihydroxy-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecane-7-carboxylic acid |
|---|
| CAS Registry Number | 863-39-8 |
|---|
| SMILES | [H][C@@]12CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])[C@H](O)C[C@@]2(C[C@H](O)CC[C@]12C)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C28H48O5/c1-16(2)7-6-8-17(3)19-9-10-20-24-21(13-23(31)27(19,20)5)26(4)12-11-18(29)14-28(26,25(32)33)15-22(24)30/h16-24,29-31H,6-15H2,1-5H3,(H,32,33)/t17-,18-,19-,20+,21+,22-,23+,24+,26-,27-,28+/m1/s1 |
|---|
| InChI Key | JIFNDZCDNLFAKC-YAODFNMUSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as cholesterols and derivatives. Cholesterols and derivatives are compounds containing a 3-hydroxylated cholestane core. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Cholestane steroids |
|---|
| Direct Parent | Cholesterols and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Cholesterol
- Cholesterol-skeleton
- Steroid acid
- 3-hydroxysteroid
- 12-hydroxysteroid
- Hydroxysteroid
- 3-alpha-hydroxysteroid
- 7-hydroxysteroid
- Cyclic alcohol
- Secondary alcohol
- Monocarboxylic acid or derivatives
- Carboxylic acid
- Polyol
- Carboxylic acid derivative
- Organooxygen compound
- Alcohol
- Organic oxide
- Organic oxygen compound
- Carbonyl group
- Hydrocarbon derivative
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 8.14 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 16.3782 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.79 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 69.1 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 3271.6 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 205.1 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 233.6 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 169.6 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 505.4 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 823.9 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 735.0 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 89.7 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1292.7 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 651.7 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1927.9 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 426.7 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 507.2 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 180.3 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 198.7 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 9.6 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Trihydroxycoprostanoic acid,1TMS,isomer #1 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O)C[C@H]3O | 3566.3 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,1TMS,isomer #2 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O)C[C@H]3O[Si](C)(C)C | 3531.3 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,1TMS,isomer #3 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@@]1(C(=O)O)C[C@H]3O | 3598.1 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,1TMS,isomer #4 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O[Si](C)(C)C)C[C@H]3O | 3503.2 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,2TMS,isomer #1 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@@]1(C(=O)O)C[C@H]3O | 3485.6 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,2TMS,isomer #2 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O[Si](C)(C)C)C[C@H]3O | 3431.1 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,2TMS,isomer #3 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O)C[C@H]3O[Si](C)(C)C | 3491.4 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,2TMS,isomer #4 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@@]1(C(=O)O)C[C@H]3O[Si](C)(C)C | 3459.1 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,2TMS,isomer #5 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O[Si](C)(C)C)C[C@H]3O[Si](C)(C)C | 3408.1 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,2TMS,isomer #6 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@@]1(C(=O)O[Si](C)(C)C)C[C@H]3O | 3430.1 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,3TMS,isomer #1 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@@]1(C(=O)O[Si](C)(C)C)C[C@H]3O | 3400.2 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,3TMS,isomer #2 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@@]1(C(=O)O)C[C@H]3O[Si](C)(C)C | 3444.4 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,3TMS,isomer #3 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O[Si](C)(C)C)C[C@H]3O[Si](C)(C)C | 3423.7 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,3TMS,isomer #4 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@@]1(C(=O)O[Si](C)(C)C)C[C@H]3O[Si](C)(C)C | 3374.9 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,4TMS,isomer #1 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@@]1(C(=O)O[Si](C)(C)C)C[C@H]3O[Si](C)(C)C | 3401.5 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,1TBDMS,isomer #1 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O)C[C@H]3O | 3780.7 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,1TBDMS,isomer #2 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O)C[C@H]3O[Si](C)(C)C(C)(C)C | 3750.6 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,1TBDMS,isomer #3 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]1(C(=O)O)C[C@H]3O | 3840.7 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,1TBDMS,isomer #4 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H]3O | 3771.4 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,2TBDMS,isomer #1 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]1(C(=O)O)C[C@H]3O | 3949.2 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,2TBDMS,isomer #2 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H]3O | 3912.2 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,2TBDMS,isomer #3 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O)C[C@H]3O[Si](C)(C)C(C)(C)C | 3933.0 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,2TBDMS,isomer #4 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]1(C(=O)O)C[C@H]3O[Si](C)(C)C(C)(C)C | 3920.5 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,2TBDMS,isomer #5 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H]3O[Si](C)(C)C(C)(C)C | 3884.5 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,2TBDMS,isomer #6 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]1(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H]3O | 3941.6 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,3TBDMS,isomer #1 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]1(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H]3O | 4118.0 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,3TBDMS,isomer #2 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]1(C(=O)O)C[C@H]3O[Si](C)(C)C(C)(C)C | 4123.2 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,3TBDMS,isomer #3 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@@]1(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H]3O[Si](C)(C)C(C)(C)C | 4108.8 | Semi standard non polar | 33892256 | | Trihydroxycoprostanoic acid,3TBDMS,isomer #4 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]1(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H]3O[Si](C)(C)C(C)(C)C | 4076.0 | Semi standard non polar | 33892256 |
|
|---|
| Disease References | | Peroxisomal biogenesis defect |
|---|
- Watkins PA, Chen WW, Harris CJ, Hoefler G, Hoefler S, Blake DC Jr, Balfe A, Kelley RI, Moser AB, Beard ME, et al.: Peroxisomal bifunctional enzyme deficiency. J Clin Invest. 1989 Mar;83(3):771-7. [PubMed:2921319 ]
| | Adrenoleukodystrophy |
|---|
- Watkins PA, Chen WW, Harris CJ, Hoefler G, Hoefler S, Blake DC Jr, Balfe A, Kelley RI, Moser AB, Beard ME, et al.: Peroxisomal bifunctional enzyme deficiency. J Clin Invest. 1989 Mar;83(3):771-7. [PubMed:2921319 ]
| | D-Bifunctional protein deficiency |
|---|
- Watkins PA, Chen WW, Harris CJ, Hoefler G, Hoefler S, Blake DC Jr, Balfe A, Kelley RI, Moser AB, Beard ME, et al.: Peroxisomal bifunctional enzyme deficiency. J Clin Invest. 1989 Mar;83(3):771-7. [PubMed:2921319 ]
|
|
|---|