Record Information |
---|
Version | 5.0 |
---|
Status | Detected and Quantified |
---|
Creation Date | 2005-11-16 15:48:42 UTC |
---|
Update Date | 2021-09-14 15:40:09 UTC |
---|
HMDB ID | HMDB0001000 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | dUDP |
---|
Description | dUDP belongs to the class of organic compounds known as pyrimidine 2'-deoxyribonucleoside diphosphates. These are pyrimidine nucleotides with a diphosphate group linked to the ribose moiety lacking a hydroxyl group at position 2. dUDP is an extremely weak basic (essentially neutral) compound (based on its pKa). dUDP exists in all eukaryotes, ranging from yeast to humans. Within humans, dUDP participates in a number of enzymatic reactions. In particular, dUDP can be biosynthesized from deoxyuridine triphosphate through its interaction with the enzyme nucleoside diphosphate kinase 6. In addition, dUDP can be biosynthesized from dUMP; which is mediated by the enzyme thymidylate synthase. In humans, dUDP is involved in the metabolic disorder called the beta-ureidopropionase deficiency pathway. Outside of the human body, dUDP has been detected, but not quantified in, several different foods, such as sour cherries, strawberries, cassava, pomes, and alpine sweetvetchs. This could make dUDP a potential biomarker for the consumption of these foods. |
---|
Structure | O[C@H]1C[C@@H](O[C@@H]1COP(O)(=O)OP(O)(O)=O)N1C=CC(=O)NC1=O InChI=1S/C9H14N2O11P2/c12-5-3-8(11-2-1-7(13)10-9(11)14)21-6(5)4-20-24(18,19)22-23(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,18,19)(H,10,13,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
---|
Synonyms | Value | Source |
---|
2'-Deoxyuridine 5'-diphosphate | ChEBI | 2'-Deoxyuridine 5'-diphosphoric acid | Generator | 2'-Deoxyuridine-5'-diphosphate | HMDB | Deoxyuridine-diphosphate | HMDB | 2'-Deoxyuridine 5'-(trihydrogen diphosphate) | HMDB | 2’-Deoxyuridine 5’-(trihydrogen diphosphate) | HMDB | 2’-Deoxyuridine 5’-diphosphate | HMDB | Deoxyuridine 5'-diphosphate | HMDB | Deoxyuridine 5’-diphosphate | HMDB | Deoxyuridine diphosphate | HMDB | dUDP | HMDB |
|
---|
Chemical Formula | C9H14N2O11P2 |
---|
Average Molecular Weight | 388.1618 |
---|
Monoisotopic Molecular Weight | 388.007282324 |
---|
IUPAC Name | [({[(2R,3S,5R)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]phosphonic acid |
---|
Traditional Name | dUDP |
---|
CAS Registry Number | 4208-67-7 |
---|
SMILES | O[C@H]1C[C@@H](O[C@@H]1COP(O)(=O)OP(O)(O)=O)N1C=CC(=O)NC1=O |
---|
InChI Identifier | InChI=1S/C9H14N2O11P2/c12-5-3-8(11-2-1-7(13)10-9(11)14)21-6(5)4-20-24(18,19)22-23(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,18,19)(H,10,13,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
---|
InChI Key | QHWZTVCCBMIIKE-SHYZEUOFSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as pyrimidine 2'-deoxyribonucleoside diphosphates. These are pyrimidine nucleotides with a diphosphate group linked to the ribose moiety lacking a hydroxyl group at position 2. |
---|
Kingdom | Organic compounds |
---|
Super Class | Nucleosides, nucleotides, and analogues |
---|
Class | Pyrimidine nucleotides |
---|
Sub Class | Pyrimidine deoxyribonucleotides |
---|
Direct Parent | Pyrimidine 2'-deoxyribonucleoside diphosphates |
---|
Alternative Parents | |
---|
Substituents | - Pyrimidine 2'-deoxyribonucleoside diphosphate
- Organic pyrophosphate
- Pyrimidone
- Monoalkyl phosphate
- Hydropyrimidine
- Organic phosphoric acid derivative
- Phosphoric acid ester
- Pyrimidine
- Alkyl phosphate
- Heteroaromatic compound
- Vinylogous amide
- Tetrahydrofuran
- Lactam
- Urea
- Secondary alcohol
- Oxacycle
- Azacycle
- Organoheterocyclic compound
- Hydrocarbon derivative
- Organooxygen compound
- Organonitrogen compound
- Organic oxide
- Organopnictogen compound
- Organic oxygen compound
- Alcohol
- Organic nitrogen compound
- Aromatic heteromonocyclic compound
|
---|
Molecular Framework | Aromatic heteromonocyclic compounds |
---|
External Descriptors | |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | |
---|
Role | |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | Not Available | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | Not Available | Not Available | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | |
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times UnderivatizedChromatographic Method | Retention Time | Reference |
---|
Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.21 minutes | 32390414 | Predicted by Siyang on May 30, 2022 | 9.3181 minutes | 33406817 | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 9.2 minutes | 32390414 | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 432.3 seconds | 40023050 | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 424.8 seconds | 40023050 | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 237.8 seconds | 40023050 | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 49.3 seconds | 40023050 | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 163.9 seconds | 40023050 | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 51.3 seconds | 40023050 | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 289.8 seconds | 40023050 | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 300.5 seconds | 40023050 | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 781.4 seconds | 40023050 | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 569.2 seconds | 40023050 | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 111.6 seconds | 40023050 | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 620.0 seconds | 40023050 | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 169.2 seconds | 40023050 | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 240.7 seconds | 40023050 | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 789.5 seconds | 40023050 | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 338.0 seconds | 40023050 | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 489.7 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
dUDP,1TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O | 3104.8 | Semi standard non polar | 33892256 | dUDP,1TMS,isomer #2 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)OP(=O)(O)O | 3181.2 | Semi standard non polar | 33892256 | dUDP,1TMS,isomer #3 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O | 3164.7 | Semi standard non polar | 33892256 | dUDP,1TMS,isomer #4 | C[Si](C)(C)N1C(=O)C=CN([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O)O2)C1=O | 3174.4 | Semi standard non polar | 33892256 | dUDP,2TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3067.4 | Semi standard non polar | 33892256 | dUDP,2TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3188.2 | Standard non polar | 33892256 | dUDP,2TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 4573.6 | Standard polar | 33892256 | dUDP,2TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 3078.3 | Semi standard non polar | 33892256 | dUDP,2TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 3187.8 | Standard non polar | 33892256 | dUDP,2TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 4643.1 | Standard polar | 33892256 | dUDP,2TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O | 3096.9 | Semi standard non polar | 33892256 | dUDP,2TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O | 3196.3 | Standard non polar | 33892256 | dUDP,2TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O | 4962.7 | Standard polar | 33892256 | dUDP,2TMS,isomer #4 | C[Si](C)(C)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)O[Si](C)(C)C | 3127.8 | Semi standard non polar | 33892256 | dUDP,2TMS,isomer #4 | C[Si](C)(C)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)O[Si](C)(C)C | 3255.2 | Standard non polar | 33892256 | dUDP,2TMS,isomer #4 | C[Si](C)(C)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)O[Si](C)(C)C | 4338.7 | Standard polar | 33892256 | dUDP,2TMS,isomer #5 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O)OP(=O)(O)O | 3157.0 | Semi standard non polar | 33892256 | dUDP,2TMS,isomer #5 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O)OP(=O)(O)O | 3252.1 | Standard non polar | 33892256 | dUDP,2TMS,isomer #5 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O)OP(=O)(O)O | 4632.1 | Standard polar | 33892256 | dUDP,2TMS,isomer #6 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O | 3134.0 | Semi standard non polar | 33892256 | dUDP,2TMS,isomer #6 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O | 3248.2 | Standard non polar | 33892256 | dUDP,2TMS,isomer #6 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O | 4360.2 | Standard polar | 33892256 | dUDP,2TMS,isomer #7 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O | 3153.4 | Semi standard non polar | 33892256 | dUDP,2TMS,isomer #7 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O | 3250.8 | Standard non polar | 33892256 | dUDP,2TMS,isomer #7 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O | 4694.6 | Standard polar | 33892256 | dUDP,3TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3077.8 | Semi standard non polar | 33892256 | dUDP,3TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3245.6 | Standard non polar | 33892256 | dUDP,3TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 4132.2 | Standard polar | 33892256 | dUDP,3TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3079.7 | Semi standard non polar | 33892256 | dUDP,3TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3261.9 | Standard non polar | 33892256 | dUDP,3TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 4342.1 | Standard polar | 33892256 | dUDP,3TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3077.8 | Semi standard non polar | 33892256 | dUDP,3TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3233.2 | Standard non polar | 33892256 | dUDP,3TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 4131.7 | Standard polar | 33892256 | dUDP,3TMS,isomer #4 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 3092.3 | Semi standard non polar | 33892256 | dUDP,3TMS,isomer #4 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 3253.4 | Standard non polar | 33892256 | dUDP,3TMS,isomer #4 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 4417.3 | Standard polar | 33892256 | dUDP,3TMS,isomer #5 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3138.5 | Semi standard non polar | 33892256 | dUDP,3TMS,isomer #5 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3292.2 | Standard non polar | 33892256 | dUDP,3TMS,isomer #5 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3886.0 | Standard polar | 33892256 | dUDP,3TMS,isomer #6 | C[Si](C)(C)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O)O[Si](C)(C)C | 3140.1 | Semi standard non polar | 33892256 | dUDP,3TMS,isomer #6 | C[Si](C)(C)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O)O[Si](C)(C)C | 3301.1 | Standard non polar | 33892256 | dUDP,3TMS,isomer #6 | C[Si](C)(C)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O)O[Si](C)(C)C | 4155.9 | Standard polar | 33892256 | dUDP,3TMS,isomer #7 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O | 3144.9 | Semi standard non polar | 33892256 | dUDP,3TMS,isomer #7 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O | 3294.9 | Standard non polar | 33892256 | dUDP,3TMS,isomer #7 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O | 4160.3 | Standard polar | 33892256 | dUDP,4TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3083.3 | Semi standard non polar | 33892256 | dUDP,4TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3279.4 | Standard non polar | 33892256 | dUDP,4TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3711.3 | Standard polar | 33892256 | dUDP,4TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3123.4 | Semi standard non polar | 33892256 | dUDP,4TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3270.3 | Standard non polar | 33892256 | dUDP,4TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3938.9 | Standard polar | 33892256 | dUDP,4TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3125.3 | Semi standard non polar | 33892256 | dUDP,4TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3263.7 | Standard non polar | 33892256 | dUDP,4TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3926.0 | Standard polar | 33892256 | dUDP,4TMS,isomer #4 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3163.8 | Semi standard non polar | 33892256 | dUDP,4TMS,isomer #4 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3309.5 | Standard non polar | 33892256 | dUDP,4TMS,isomer #4 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3711.3 | Standard polar | 33892256 | dUDP,5TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3167.0 | Semi standard non polar | 33892256 | dUDP,5TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3253.8 | Standard non polar | 33892256 | dUDP,5TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3534.6 | Standard polar | 33892256 | dUDP,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O | 3342.0 | Semi standard non polar | 33892256 | dUDP,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)OP(=O)(O)O | 3407.6 | Semi standard non polar | 33892256 | dUDP,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O | 3401.1 | Semi standard non polar | 33892256 | dUDP,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N1C(=O)C=CN([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O)O2)C1=O | 3396.9 | Semi standard non polar | 33892256 | dUDP,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 3529.6 | Semi standard non polar | 33892256 | dUDP,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 3627.7 | Standard non polar | 33892256 | dUDP,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 4686.0 | Standard polar | 33892256 | dUDP,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 3541.5 | Semi standard non polar | 33892256 | dUDP,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 3630.6 | Standard non polar | 33892256 | dUDP,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 4744.0 | Standard polar | 33892256 | dUDP,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O | 3561.3 | Semi standard non polar | 33892256 | dUDP,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O | 3615.3 | Standard non polar | 33892256 | dUDP,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O | 4904.0 | Standard polar | 33892256 | dUDP,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3560.7 | Semi standard non polar | 33892256 | dUDP,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3645.9 | Standard non polar | 33892256 | dUDP,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 4509.8 | Standard polar | 33892256 | dUDP,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O)OP(=O)(O)O | 3606.6 | Semi standard non polar | 33892256 | dUDP,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O)OP(=O)(O)O | 3646.2 | Standard non polar | 33892256 | dUDP,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O)OP(=O)(O)O | 4694.2 | Standard polar | 33892256 | dUDP,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O | 3561.5 | Semi standard non polar | 33892256 | dUDP,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O | 3626.7 | Standard non polar | 33892256 | dUDP,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O | 4533.6 | Standard polar | 33892256 | dUDP,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O | 3604.4 | Semi standard non polar | 33892256 | dUDP,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O | 3646.4 | Standard non polar | 33892256 | dUDP,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O | 4747.5 | Standard polar | 33892256 | dUDP,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 3716.9 | Semi standard non polar | 33892256 | dUDP,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 3838.8 | Standard non polar | 33892256 | dUDP,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 4307.0 | Standard polar | 33892256 | dUDP,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 3761.7 | Semi standard non polar | 33892256 | dUDP,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 3826.7 | Standard non polar | 33892256 | dUDP,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 4461.6 | Standard polar | 33892256 | dUDP,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3717.0 | Semi standard non polar | 33892256 | dUDP,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3810.1 | Standard non polar | 33892256 | dUDP,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4317.0 | Standard polar | 33892256 | dUDP,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 3761.4 | Semi standard non polar | 33892256 | dUDP,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 3828.0 | Standard non polar | 33892256 | dUDP,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 4529.2 | Standard polar | 33892256 | dUDP,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3733.0 | Semi standard non polar | 33892256 | dUDP,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3831.3 | Standard non polar | 33892256 | dUDP,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)[NH]C2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4090.2 | Standard polar | 33892256 | dUDP,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3802.4 | Semi standard non polar | 33892256 | dUDP,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3855.8 | Standard non polar | 33892256 | dUDP,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 4295.3 | Standard polar | 33892256 | dUDP,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O | 3798.8 | Semi standard non polar | 33892256 | dUDP,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O | 3833.9 | Standard non polar | 33892256 | dUDP,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O | 4305.9 | Standard polar | 33892256 | dUDP,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3887.0 | Semi standard non polar | 33892256 | dUDP,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3921.0 | Standard non polar | 33892256 | dUDP,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)[NH]C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3959.9 | Standard polar | 33892256 | dUDP,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 3971.2 | Semi standard non polar | 33892256 | dUDP,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 3940.0 | Standard non polar | 33892256 | dUDP,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 4117.1 | Standard polar | 33892256 | dUDP,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3969.8 | Semi standard non polar | 33892256 | dUDP,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3915.5 | Standard non polar | 33892256 | dUDP,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4123.6 | Standard polar | 33892256 | dUDP,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3991.0 | Semi standard non polar | 33892256 | dUDP,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3940.2 | Standard non polar | 33892256 | dUDP,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)N([Si](C)(C)C(C)(C)C)C2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3934.4 | Standard polar | 33892256 |
|
---|
General References | - Diaz C, Valverde L, Brenes O, Rucavado A, Gutierrez JM: Characterization of events associated with apoptosis/anoikis induced by snake venom metalloproteinase BaP1 on human endothelial cells. J Cell Biochem. 2005 Feb 15;94(3):520-8. [PubMed:15543558 ]
- Lambard S, Galeraud-Denis I, Martin G, Levy R, Chocat A, Carreau S: Analysis and significance of mRNA in human ejaculated sperm from normozoospermic donors: relationship to sperm motility and capacitation. Mol Hum Reprod. 2004 Jul;10(7):535-41. Epub 2004 Apr 20. [PubMed:15100385 ]
- Wang J, Ohara N, Takekida S, Xu Q, Maruo T: Comparative effects of heparin-binding epidermal growth factor-like growth factor on the growth of cultured human uterine leiomyoma cells and myometrial cells. Hum Reprod. 2005 Jun;20(6):1456-65. Epub 2005 Mar 10. [PubMed:15760954 ]
- Di Simone N, Riccardi P, Maggiano N, Piacentani A, D'Asta M, Capelli A, Caruso A: Effect of folic acid on homocysteine-induced trophoblast apoptosis. Mol Hum Reprod. 2004 Sep;10(9):665-9. Epub 2004 Jul 30. [PubMed:15286211 ]
- Duran EH, Morshedi M, Taylor S, Oehninger S: Sperm DNA quality predicts intrauterine insemination outcome: a prospective cohort study. Hum Reprod. 2002 Dec;17(12):3122-8. [PubMed:12456611 ]
- Henkel R, Hajimohammad M, Stalf T, Hoogendijk C, Mehnert C, Menkveld R, Gips H, Schill WB, Kruger TF: Influence of deoxyribonucleic acid damage on fertilization and pregnancy. Fertil Steril. 2004 Apr;81(4):965-72. [PubMed:15066449 ]
- Brunk E, Sahoo S, Zielinski DC, Altunkaya A, Drager A, Mih N, Gatto F, Nilsson A, Preciat Gonzalez GA, Aurich MK, Prlic A, Sastry A, Danielsdottir AD, Heinken A, Noronha A, Rose PW, Burley SK, Fleming RMT, Nielsen J, Thiele I, Palsson BO: Recon3D enables a three-dimensional view of gene variation in human metabolism. Nat Biotechnol. 2018 Mar;36(3):272-281. doi: 10.1038/nbt.4072. Epub 2018 Feb 19. [PubMed:29457794 ]
|
---|