Showing structure for O=C(OCC1CCCO1)C1=CN=CC=C1