Showing structure for NC(=S)C1=C[N+](=CC=C1)C1OC(COP(O)(=O)OP(O)(=O)OCC2OC(C(O)C2O)N2C=NC3=C2N=CN=C3N)C(O)C1[O-]