Showing structure for CCOP(C)(=O)O[Si](C)(C)C(C)(C)C