Showing structure for CCC1(CC)C(=O)NC(=S)N([Si](C)(C)C(C)(C)C)C1=O