Showing structure for CC1=CN(C2CC(OP(=O)(O)O)C(CO)O2)C(=O)N=C1O[Si](C)(C)C