Showing structure for CC1=CN([C@H]2CC3OP(O)(=O)OCC3O2)C(=O)NC1=O