Showing structure for CC(CC1=CN=C[NH]1)N[Si](C)(C)C