Showing structure for CC(C)(C)[Si](C)(C)OP(=O)(O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O)O[Si](C)(C)C(C)(C)C