Showing structure for CC(C)(C)[Si](C)(C)OC1C=CC=C(Br)C1O