Showing structure for CC(C)(C)[Si](C)(C)OC(=O)C[C@](C)(O)CCOP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C