Showing structure for CC(C)(C)[Si](C)(C)NC[C@@H](CC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C