Showing structure for CC(C)(C)[Si](C)(C)N(CCC#N)[Si](C)(C)C(C)(C)C