Showing structure for C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C