Showing structure for C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O