Showing structure for C[Si](C)(C)OC=CC[C@H](C(=O)O)N(C(=O)CC[C@@H](NC(=O)CC[C@H](C(=O)O)N(C(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C