Showing structure for C[Si](C)(C)OC(=O)[C@@H](CCC=O)NC(=O)CC[C@H](C(=O)O)N(C(=O)CC[C@H](C(=O)O)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)[Si](C)(C)C