Showing structure for C[Si](C)(C)NC[C@@H](CC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)OP(=O)(O)O