Showing structure for C[Si](C)(C)N=C(N)NS(=O)(=O)C1=CC=C(N[Si](C)(C)C)C=C1