Showing structure for C[Si](C)(C)N(CC1=CC=C(O)C=C1)[Si](C)(C)C