Showing structure for C[Si](C)(C)N[C@@H](CC[C@H](CN)OP(=O)(O)O)C(=O)O