Showing structure for C[C@@H](O)[C@@H](C(=O)N([C@@H](CCCN(C(=N)N[Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C