Showing structure for C[C@@H](O)[C@@H](C(=O)N[C@@H](CCCNC(N)=N[Si](C)(C)C(C)(C)C)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C