Showing structure for C[C@@H](O[Si](C)(C)C)[C@@H](C(=O)N([C@@H](CCCNC(=N)N)C(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C