Showing structure for C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N[C@@H](CCCNC(N)=N[Si](C)(C)C(C)(C)C)C(=O)O